| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 97-64-3 |
| ECHA EC Number: | 202-598-0 |
| FDA UNII: | F3P750VW8I |
| CoE Number: | 371 |
| Category: | flavor and fragrance agents, carrier solvents |
| IUPAC Name: | ethyl lactate |
| InChI : | InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
| Std.InChI: | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
| InChIKey : | LZCLXQDLBQLTDK-UHFFFAOYAV |
| Std.InChIKey: | LZCLXQDLBQLTDK-UHFFFAOYSA-N |
| SMILES : | CCOC(=O)C(C)O |
| MDL: | MFCD00065359 |
| Molar Refractivity : | 28.48 ± 0.3 cm3 (est) |
| Parachor : | 269.9 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.420 ± 0.02 (est) |
| Surface Tension : | 33.2 ± 3.0 dyne/cm (est) |
| Density : | 1.050 ± 0.06 g/cm3 (est) |
| Polarizability : | 11.29 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 931 ethyl lactate |
| JECFA Food Additive: | Ethyl Lactate |
| DG SANTE Food Flavourings: | 09.433 ethyl lactate |
| FEMA Number: | 2440 ethyl lactate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 97-64-3 ; ETHYL LACTATE |
| FDA Regulation: | |
| FDA PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION Subpart F--Flavoring Agents and Related Substances Sec. 172.515 Synthetic flavoring substances and adjuvants. FDA PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS Subpart B--Substances for Use Only as Components of Adhesives Sec. 175.105 Adhesives. | |
| Appearance: | colorless clear liquid (est) |
| Assay: | 97.00 to 100.00 |
| Food Chemicals Codex Listed: | Yes |
| Specific Gravity: | 1.02900 to 1.03700 @ 25.00 °C. |
| Pounds per Gallon - (est).: | 8.562 to 8.629 |
| Refractive Index: | 1.40800 to 1.42200 @ 20.00 °C. |
| Melting Point: | -26.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 154.00 °C. @ 760.00 mm Hg |
| Acid Value: | 1.00 max. KOH/g |
| Vapor Pressure: | 1.163000 mmHg @ 25.00 °C. (est) |
| Vapor Density: | 4.07 ( Air = 1 ) |
| Flash Point: | 120.00 °F. TCC ( 48.89 °C. ) |
| logP (o/w): | -0.039 (est) |
| Shelf Life: | 12.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: | |
| alcohol | |
| isopropyl myristate | |
| water, 4.728e+005 mg/L @ 25 °C (est) | |
| ether | |
| chloroform | |
| water, 1.00E+06 mg/L @ 20 °C (exp) | |
| Insoluble in: | |
| paraffin oil | |
| Similar Items:note | |
| amyl lactate | |
| isoamyl lactate | |
| benzyl lactate | |
| butyl butyryl lactate | |
| butyl lactate | |
| isobutyl lactate | |
| sec-butyl lactate | |
| butyl laevo-lactate | |
| cetyl lactate | |
| dodecyl lactate | |
| ethyl acetyl lactate | |
| ethyl butyryl lactate | |
| ethyl phenyl lactate | |
| (Z)-3-hexen-1-yl lactate | |
| hexyl lactate | |
| laevo-menthyl lactate | |
| menthyl methyl lactate | |
| methyl dextro-lactate | |
| methyl laevo-lactate | |
| phenethyl lactate | |
| propyl lactate | |
| vanillyl lactate | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | perfuming agents solvents |
| Preferred SDS: View | |
| European information : | |
| Most important hazard(s): | |
| Xi - Irritant | |
| R 10 - Flammable. R 37 - Irritating to respiratory system. R 41 - Risk of serious damage to eyes. S 02 - Keep out of the reach of children. S 16 - Keep away from sources of ignition - No Smoking. S 23 - Do not breath vapour. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 39 - Wear eye/face protection. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Human Experience: | |
| 8 % solution: no irritation or sensitization. | |
| Oral/Parenteral Toxicity: | |
| oral-rat LD50 8200 mg/kg International Journal of Toxicology. Vol. 17(Suppl oral-mouse LD50 2500 mg/kg Journal of Pharmacology and Experimental Therapeutics. Vol. 65, Pg. 89, 1939. intravenous-mouse LD50 600 mg/kg Journal of Pharmacology and Experimental Therapeutics. Vol. 65, Pg. 89, 1939. intramuscular-guinea pig LDLo 2605 mg/kg LUNGS, THORAX, OR RESPIRATION: DYSPNEA Journal of Pharmacology and Experimental Therapeutics. Vol. 76, Pg. 189, 1942. intraperitoneal-rat LDLo 1000 mg/kg LUNGS, THORAX, OR RESPIRATION: OTHER CHANGESBEHAVIORAL: MUSCLE WEAKNESSLUNGS, THORAX, OR RESPIRATION: CYANOSIS Journal of Pharmacy and Pharmacology. Vol. 11, Pg. 150, 1959. | |
| Dermal Toxicity: | |
| skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 677, 1982. subcutaneous-mouse LD50 2500 mg/kg Journal of Pharmacology and Experimental Therapeutics. Vol. 65, Pg. 89, 1939. | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents, carrier solvents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for ethyl lactate usage levels up to: | |||
| 12.0000 % in the fragrance concentrate. | |||
| Maximised Survey-derived Daily Intakes (MSDI-EU): | 1600.00 (μg/capita/day) | ||
| Maximised Survey-derived Daily Intakes (MSDI-USA): | 760.00 (μg/capita/day) | ||
| Structure Class: | I | ||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 3 | |||
| Click here to view publication 3 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | 71.00000 | |
| beverages(nonalcoholic): | - | 5.40000 | |
| beverages(alcoholic): | - | 1000.00000 | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | 580.00000 | 3100.00000 | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | 17.00000 | |
| fruit ices: | - | 17.00000 | |
| gelatins / puddings: | - | 8.30000 | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | 28.00000 | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| European Food Safety Athority(EFSA):Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| European Food Safety Authority (EFSA) reference(s): |
| Flavouring Group Evaluation 64 (FGE.64): Consideration of aliphatic acyclic diols, triols, and related substances evaluated by JECFA (57th meeting) structurally related to aliphatic primary and secondary saturated and unsaturated alcohols, aldehydes, acetals, carboxylic acids and esters containing an additional oxygenated functional group and lactones from chemical groups 9, 13 and 30 evaluated by EFSA in FGE.10Rev1 (EFSA, 2008ab) View page or View pdf |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):97-64-3 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :7344 |
| National Institute of Allergy and Infectious Diseases:Data |
| WISER:UN 1192 |
| WGK Germany:1 |
| ethyl 2-hydroxypropanoate |
| Chemidplus:0000097643 |
| EPA/NOAA CAMEO:hazardous materials |
| RTECS:OD5075000 for cas# 97-64-3 |
| ethyl 2-hydroxypropanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 97-64-3 |
| Pubchem (cid): | 7344 |
| Pubchem (sid): | 134970641 |
| Flavornet: | 97-64-3 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| FDA Indirect Additives used in Food Contact Substances: | View |
| CHEBI: | View |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | HMDB40735 |
| FooDB: | FDB020545 |
| YMDB (Yeast Metabolome Database): | YMDB01685 |
| Export Tariff Code: | 2918.11.5100 |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| Wikipedia: | View |
| Formulations/Preparations: grades: technical (96%). | |
| FR | almond |
| FR | apple |
| FR | crabapple |
| FR | apple green apple |
| FL | beer bantu beer |
| FL | bread white bread |
| FR | butterscotch |
| FL | caramel |
| FL | cheese |
| FR | cherry |
| FL | cherry maraschino cherry |
| FL | chervil |
| FR | chestnut blossom |
| FL | chocolate cocoa |
| FL/FR | cilantro |
| FR | clary sage oil replacer |
| FL | cloudberry bakeapple |
| FR | coconut |
| FR | cognac |
| FR | cologne |
| FR | cranberry |
| FR | dogwood |
| ethereal | |
| FR | fig |
| FR | grape |
| FR | grapefruit |
| FL | horseradish |
| FR | ivy |
| FR | lychee |
| FL | mustard |
| FL | nut |
| FL/FR | orange bitter orange peel |
| FR | palmarosa oil replacer |
| FR | patchouli |
| FL | pea green pea |
| FL | brandy pear brandy |
| peel | |
| FL | pepper tabasco pepper |
| FR | pineapple |
| FL | brandy plum brandy |
| FL | plum greengage plum |
| FL | radish |
| FR | rhubarb |
| FR | saffron |
| FL | saki |
| FL | sauerkraut |
| FR | sherry |
| FR | spruce |
| FR | strawberry |
| strawberry leaf | |
| FL | vinegar |
| FL | wasabi |
| watercress nasturtium | |
| FR | wormwood oil replacer |
| actylol | |
| acytol | |
| ethyl 2-hydroxypropanoate | |
| ethyl 2-hydroxypropionate | |
| ethyl alpha-hydroxypropionate | |
| ethyl lactate (ethyl 2-hydroxypropanoate) | |
| ethyl lactate (natural) | |
| ethyl lactate electronic grade | |
| ethyl lactate FCC | |
| ethyl lactate FCC natural | |
| ethyl lactate natural | |
| ethyl lactate natural fcc | |
| ethyl lactate solvent grade | |
| ethyl lactate synthetic | |
| ethyl-lactate supra | |
| 2- | hydroxypropanoic acid ethyl ester |
| 2- | hydroxypropionic acid ethyl ester |
| lactic acid ethyl ester | |
| propanoic acid, 2-hydroxy-, ethyl ester | |
| solactol |
