| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 97-24-5 |
| ECHA EC Number: | 202-568-7 |
| FDA UNII: | D61659OVD0 |
| Category: | antimicrobial agents |
| IUPAC Name: | 2,2-thiobis(4-chlorophenol) |
| InChI : | InChI=1/C12H8Cl2O2S/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16/h1-6,15-16H |
| Std.InChI: | InChI=1S/C12H8Cl2O2S/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16/h1-6,15-16H |
| InChIKey : | ANUSOIHIIPAHJV-UHFFFAOYAT |
| Std.InChIKey: | ANUSOIHIIPAHJV-UHFFFAOYSA-N |
| SMILES : | C1=CC(=C(C=C1Cl)SC2=C(C=CC(=C2)Cl)O)O |
| MDL: | MFCD00031479 |
| Molar Refractivity : | 72.18 ± 0.4 cm3 (est) |
| Parachor : | 534.5 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.730 ± 0.03 (est) |
| Surface Tension : | 76.4 ± 5.0 dyne/cm (est) |
| Density : | 1.58 ± 0.1 g/cm3 (est) |
| Polarizability : | 28.61 ± 0.5 10-24cm3 (est) |
| Appearance: | white to cream powder (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Melting Point: | 174.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 416.70 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 402.00 °F. TCC ( 205.80 °C. ) (est) |
| logP (o/w): | 4.400 (est) |
| Soluble in: | |
| water, 6.293 mg/L @ 25 °C (est) | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | antimicrobial agents |
| Matrix Scientific |
| For experimental / research use only. |
| 2,2'-Thiobis(4-chlorophenol) |
| Sigma-Aldrich: Aldrich |
| For experimental / research use only. |
| 2,2'-Thiobis(4-chlorophenol) |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| intraperitoneal-mouse LDLo 250 mg/kg "Summary Tables of Biological Tests," National Research Council Chemical-Biological Coordination Center. Vol. 7, Pg. 788, 1955. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| antimicrobial agents | |||
| Recommendation for 2,2-thiobis(4-chlorophenol) usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for 2,2-thiobis(4-chlorophenol) flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| Chemical Carcinogenesis Research Information System:Search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :7329 |
| National Institute of Allergy and Infectious Diseases:Data |
| 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol |
| Chemidplus:0000097245 |
| EPA/NOAA CAMEO:hazardous materials |
| 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 7329 |
| Pubchem (sid): | 134973009 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| CHEMBL: | View |
| KEGG (GenomeNet): | D04164 |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| antimicrobial agents |
| not found in nature |
| 4- | chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol |
| 4- | chloro-2-(5-chloro-2-hydroxyphenylthio)phenol |
| 4- | chloro-2-[(5-chloro-2-hydroxyphenyl)sulfanyl]phenol |
| di(2-hydroxy-5-chlorphenyl)thioether | |
| 5,5'- | dichloro-2,2'-dihydroxydiphenyl sulfide |
| 2,2'- | dihydroxy-5, 5'-dichlorophenyl sulfide |
| 2,2'- | dihydroxy-5,5'-dichlorodiphenyl sulfide |
| 2,2'- | dihydroxy-5,5'-dichlorophenyl sulfide |
| fentichlor | |
| fenticlor | |
| fenticlor [USAN:BAN:INN] [INN] [USAN] | |
| bis(2- | hydroxy-5-chlorophenyl) sulfide |
| bis(2- | hydroxy-5-chlorophenyl)sulfide |
| bis[2- | hydroxy-5-chlorophenyl]sulfide |
| meflorin | |
| novex | |
| oksid | |
| ovitrol | |
| phenol, 2,2'-thiobis[4-chloro- | |
| phentichlorum | |
| 2,2'- | sulfanediylbis(4-chlorophenol) |
| 2,2'- | sulfanediylbis(4-chlorphenol) |
| 2,2'- | thiobis(4-chlorophenol) |
| 2,2'- | thiobis[4-chlorophenol] |
| None found yet. Try the PubMed Search. |
