trimethyl-3-nonenol
fragrance agents
| 2D: |
 |
| 3D: |
|
| CAS Number: |
93882-22-5
|
| ECHA EC Number: |
299-419-1 |
| FDA UNII: |
Search |
| Category: |
fragrance agents |
| IUPAC Name: |
trimethyl-3-nonenol |
| InChI : |
InChI=1/C12H24O/c1-10(2)8-6-7-9-11(13)12(3,4)5/h9-10,13H,6-8H2,1-5H3/b11-9- |
| Std.InChI: |
InChI=1S/C12H24O/c1-10(2)8-6-7-9-11(13)12(3,4)5/h9-10,13H,6-8H2,1-5H3/b11-9- |
| InChIKey : |
PKDBKVJGYKPROI-LUAWRHEFBH |
| Std.InChIKey: |
PKDBKVJGYKPROI-LUAWRHEFSA-N |
| SMILES : |
CC(C)CCC/C=C(/C(C)(C)C)\O |
| Molar Refractivity : |
59.00 ± 0.3 cm3 (est) |
| Parachor : |
502.1 ± 4.0 cm3 (est) |
| Index of Refraction : |
1.453 ± 0.02 (est) |
| Surface Tension : |
28.1 ± 3.0 dyne/cm (est) |
| Density : |
0.845 ± 0.06 g/cm3 (est) |
| Polarizability : |
23.39 ± 0.5 10-24cm3 (est) |
|
Fragrance Demo Formulas
|
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 245.00 to 247.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.004000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 217.00 °F. TCC ( 102.60 °C. ) (est) |
| logP (o/w): | 5.228 (est) |
| Soluble in: |
| | alcohol |
| | water, 3.11 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
| Not determined |
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| | corps lavande |
| | nonen-3-ol, 2,2,8-trimethyl- |
| 2,2,8- | trimethyl nonen-3-ol |
| (Z)-2,2,8- | trimethylnon-3-en-3-ol |
| 2,2,8- | trimethylnonen-3-ol |
