| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 7360-38-5 |
| ECHA EC Number: | 230-896-0 |
| FDA UNII: | 7K3W1BIU6K |
| Category: | cosmetic agents |
| IUPAC Name: | triethylhexanoin |
| InChI : | InChI=1/C27H50O6/c1-7-13-16-21(10-4)25(28)31-19-24(33-27(30)23(12-6)18-15-9-3)20-32-26(29)22(11-5)17-14-8-2/h21-24H,7-20H2,1-6H3 |
| Std.InChI: | InChI=1S/C27H50O6/c1-7-13-16-21(10-4)25(28)31-19-24(33-27(30)23(12-6)18-15-9-3)20-32-26(29)22(11-5)17-14-8-2/h21-24H,7-20H2,1-6H3 |
| InChIKey : | DGSZGZSCHSQXFV-UHFFFAOYAM |
| Std.InChIKey: | DGSZGZSCHSQXFV-UHFFFAOYSA-N |
| SMILES : | CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| Molar Refractivity : | 132.29 ± 0.3 cm3 (est) |
| Parachor : | 1170.0 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.456 ± 0.02 (est) |
| Surface Tension : | 33.5 ± 3.0 dyne/cm (est) |
| Density : | 0.968 ± 0.06 g/cm3 (est) |
| Polarizability : | 52.44 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 498.00 to 499.00 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 401.00 °F. TCC ( 204.80 °C. ) (est) |
| logP (o/w): | 8.919 (est) |
| Soluble in: | |
| water, 2.351e-005 mg/L @ 25 °C (est) | |
| American International Chemical, LLC. |
| Triethylhexanoin |
| BOC Sciences |
| For experimental / research use only. |
| Glyceryl tri(2-ethylhexanoate) |
| Chemical-navi - Nikkol |
| NIKKOL Trifat S-308 Odor: characteristic Use: Superior oxidation and hydrolysis stability compared to natural oils; light feel |
| Croda |
| Crodamol™ GTEH Odor: bland Use: Light and elegant skin feel, easy spreading, dry lubrication with exceptional skin coverage. Ideal for sunscreen applications. |
| Lubrizol Corporation |
| Schercemol™ GTO Ester |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| cosmetic agents | |||
| Recommendation for triethylhexanoin usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for triethylhexanoin flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):7360-38-5 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :110973 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:1 |
| 2,3-bis(2-ethylhexanoyloxy)propyl 2-ethylhexanoate |
| Chemidplus:0007360385 |
| 2,3-bis(2-ethylhexanoyloxy)propyl 2-ethylhexanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 110973 |
| Pubchem (sid): | 135067972 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| KEGG (GenomeNet): | C20355 |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| antistatic agents | |
| emollients | |
| solvents |
| not found in nature |
| crodamol GTEH | |
| 2,3-bis(2- | ethylhexanoyloxy)propyl 2-ethylhexanoate |
| glycerol, tris-(2-ethylhexanoate) | |
| glyceryl tri(2-ethylhexanoate) | |
| glyceryl trioctanoate | |
| nikkol trifat S-308 | |
| octanoic acid 1,2,3-propanetriol ester | |
| octanoic acid, 1,2,3-propanetriol ester | |
| propane-1,2,3-triyl 2-ethyl hexanoate | |
| propane-1,2,3-triyl 2-ethylhexanoate | |
| schercemol GTO ester | |
| triethyl hexanoin |
