| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 72109-82-1 |
| ECHA EC Number: | 276-348-4 |
| FDA UNII: | Search |
| Category: | information only not used for fragrances or flavors |
| IUPAC Name: | nonyl phenyl acetate |
| InChI : | InChI=1/C17H26O2/c1-2-3-4-5-6-7-11-14-19-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| Std.InChI: | InChI=1S/C17H26O2/c1-2-3-4-5-6-7-11-14-19-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| InChIKey : | QICYMLLAPDCBNZ-UHFFFAOYAQ |
| Std.InChIKey: | QICYMLLAPDCBNZ-UHFFFAOYSA-N |
| SMILES : | CCCCCCCCCOC(=O)CC1=CC=CC=C1 |
| Molar Refractivity : | 79.27 ± 0.3 cm3 (est) |
| Parachor : | 666.6 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.489 ± 0.02 (est) |
| Surface Tension : | 34.8 ± 3.0 dyne/cm (est) |
| Density : | 0.956 ± 0.06 g/cm3 (est) |
| Polarizability : | 31.42 ± 0.5 10-24cm3 (est) |
| None found |
| Aston Chemical |
| For experimental / research use only. |
| Nonyl Phenylacetate |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| information only not used for fragrances or flavors | |||
| Recommendation for nonyl phenyl acetate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for nonyl phenyl acetate flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :562667 |
| National Institute of Allergy and Infectious Diseases:Data |
| nonyl 2-phenylacetate |
| Chemidplus:0072109821 |
| nonyl 2-phenylacetate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 562667 |
| Pubchem (sid): | 135248527 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 2916.35.1500 |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| benzene acetic acid nonyl ester | |
| benzeneacetic acid, nonyl ester | |
| nonyl 2-phenylacetate | |
| nonyl phenylacetate | |
| phenyl acetic acid nonyl ester | |
| phenylacetic acid, nonyl ester |
| None found yet. Try the PubMed Search. |
