| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 71605-84-0 |
| ECHA EC Number: | 275-663-4 |
| FDA UNII: | Search |
| Category: | fragrance agents |
| IUPAC Name: | geranyl cinnamate |
| InChI : | InChI=1/C19H24O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-14H,7,9,15H2,1-3H3/b13-12+,17-14+ |
| Std.InChI: | InChI=1S/C19H24O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-14H,7,9,15H2,1-3H3/b13-12+,17-14+ |
| InChIKey : | JCWXWRIQSPDSKY-MIFVOYFBBZ |
| Std.InChIKey: | JCWXWRIQSPDSKY-MIFVOYFBSA-N |
| SMILES : | CC(=CCC/C(=C/COC(=O)/C=C/C1=CC=CC=C1)/C)C |
| Molar Refractivity : | 90.04 ± 0.3 cm3 (est) |
| Parachor : | 699.6 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.542 ± 0.02 (est) |
| Surface Tension : | 35.9 ± 3.0 dyne/cm (est) |
| Density : | 0.995 ± 0.06 g/cm3 (est) |
| Polarizability : | 35.69 ± 0.5 10-24cm3 (est) |
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 1.07500 @ 25.00 °C. |
| Refractive Index: | 1.53800 @ 25.00 °C. |
| Boiling Point: | 384.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 407.00 to 408.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.002630 mmHg @ 25.00 °C. (est) |
| Flash Point: | 444.00 °F. TCC ( 228.80 °C. ) (est) |
| logP (o/w): | 6.039 (est) |
| Soluble in: | |
| alcohol | |
| water, 0.04605 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| None found |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for geranyl cinnamate flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :5862476 |
| National Institute of Allergy and Infectious Diseases:Data |
| [(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-phenylprop-2-enoate |
| Chemidplus:0071605840 |
| [(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-phenylprop-2-enoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 5862476 |
| Pubchem (sid): | 135198678 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| For Odor |
| amber |
| ambrain FR |
| balsamic |
| amyl cinnamate FL/FR |
| butyl benzoate FL/FR |
| tolu balsam FL/FR |
| tolu balsam replacer FR |
| floral |
| amyl benzoate FL/FR |
| rosa odorata flower oil FR |
| fruity |
| thesaron (Takasago) FR |
| musk |
| juniper lactone FL/FR |
| woody |
| cedarwood acetate FR |
| cistus twig/leaf absolute FR |
| cistus twig/leaf oil FL/FR |
| vetiver oil CO2 extract FL/FR |
| vetiver oil haiti MD FL/FR |
| For Flavor |
| No flavor group found for these |
| amyl benzoate FL/FR |
| butyl benzoate FL/FR |
| balsamic |
| balsamic |
| amyl cinnamate FL/FR |
| tolu balsam FL/FR |
| musk |
| juniper lactone FL/FR |
| woody |
| cistus twig/leaf oil FL/FR |
| vetiver oil CO2 extract FL/FR |
| vetiver oil haiti MD FL/FR |
| not found in nature |
| (,6E)-3,7- | dimethyl-2,6-octadienyl cinnamate |
| (E)-3,7- | dimethyl-2,6-octadienyl cinnamate |
| [(2E)-3,7- | dimethylocta-2,6-dienyl] (E)-3-phenylprop-2-enoate |
