| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 7089-44-3 |
| FDA UNII: | Search |
| Category: | natural substances and extractives |
| IUPAC Name: | (Z)-4-tetradecenoic acid |
| InChI : | InChI=1/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h10-11H,2-9,12-13H2,1H3,(H,15,16)/b11-10- |
| Std.InChI: | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h10-11H,2-9,12-13H2,1H3,(H,15,16)/b11-10- |
| InChIKey : | CUVLOCDGQCUQSI-KHPPLWFEBC |
| Std.InChIKey: | CUVLOCDGQCUQSI-KHPPLWFESA-N |
| SMILES : | CCCCCCCCC/C=C\CCC(=O)O |
| Molar Refractivity : | 68.53 ± 0.3 cm3 (est) |
| Parachor : | 598.1 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.465 ± 0.02 (est) |
| Surface Tension : | 33.9 ± 3.0 dyne/cm (est) |
| Density : | 0.913 ± 0.06 g/cm3 (est) |
| Polarizability : | 27.16 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Soluble in: | |
| water, 0.9431 mg/L @ 25 °C (est) | |
| None found |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| natural substances and extractives | |||
| Recommendation for (Z)-4-tetradecenoic acid usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for (Z)-4-tetradecenoic acid flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :5312399 |
| National Institute of Allergy and Infectious Diseases:Data |
| (Z)-tetradec-4-enoic acid |
| (Z)-tetradec-4-enoic acid | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 5312399 |
| Pubchem (sid): | 39342012 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | HMDB05051 |
| FooDB: | FDB023613 |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| None Found |
| None Found |
| found in nature |
| (4Z)- | tetradec-4-enoic acid |
| (Z)- | tetradec-4-enoic acid |
| (4Z)-4- | tetradecenoic acid |
| cis-4- | tetradecenoic acid |
| 4- | tetradecenoic acid, (4Z)- |
| 4- | tetradecenoic acid, (Z)- |
| 4- | tetradecenoic acid, cis- |
| tsuzuic acid |
| None found yet. Try the PubMed Search. |
