| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 68908-82-7 |
| ECHA EC Number: | 272-683-5 |
| FDA UNII: | Search |
| Category: | fragrance agents |
| IUPAC Name: | indolall |
| InChI : | InChI=1/C10H20O2.C8H7N/c1-9(6-8-11)5-4-7-10(2,3)12;1-2-4-8-7(3-1)5-6-9-8/h8-9,12H,4-7H2,1-3H3;1-6,9H |
| Std.InChI: | InChI=1S/C10H20O2.C8H7N/c1-9(6-8-11)5-4-7-10(2,3)12;1-2-4-8-7(3-1)5-6-9-8/h8-9,12H,4-7H2,1-3H3;1-6,9H |
| InChIKey : | NSBPKSMZAAJTFE-UHFFFAOYAQ |
| Std.InChIKey: | NSBPKSMZAAJTFE-UHFFFAOYSA-N |
| SMILES : | CC(CCCC(C)(C)O)CC=O.C1=CC=C2C(=C1)C=CN2 |
| Fragrance Demo Formulas | |
| Appearance: | yellow to amber viscous liquid (est) |
| Assay: | 98.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 251.60 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.003180 mmHg @ 25.00 °C. (est) |
| Flash Point: | 219.00 °F. TCC ( 103.80 °C. ) (est) |
| logP (o/w): | 1.539 (est) |
| Soluble in: | |
| alcohol | |
| water, 2.854 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| Stability: | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | perfuming agents |
| Augustus Oils |
| Indolene Liquid |
| Services |
| Azelis UK |
| INDOLENE 50 PCT DEP |
| Berjé |
| Indolene |
| Media |
| Charabot |
| Schiff indol hydroxy 50 rh Odor: Floral, white flower, sweet |
| Ernesto Ventós |
| INDOLEN 50 Odor: ANIMAL, FLORAL, JASMINE |
| IFF |
| Indolene 50% BB Odor: A floral, jasmin note with slight animalic character which is useful in extending natural absolute Jasmin Use: Modified animal, fecal note useful in floral absolute types. Increases the substantivity of a fragrance and provides fixation as well as floralcy. |
| IFF |
| Indolene 50% DEP Odor: A floral, jasmin note with slight animalic character which is useful in extending natural absolute Jasmin |
| Lluch Essence |
| SCHIFF BASE INDOLE/HYDROXYCITRONELLAL 50% CASTOR OIL |
| M&U International |
| Indolene 50 |
| Moellhausen |
| INDOLENE BASE |
| Penta International |
| INDOLENE 50 |
| PerfumersWorld |
| Indolene Odor: strong narcotic-floral moth ball naphthelene erogenic-floral animal jasmine orange-flower Use: Blends-well-with - White Florals |
| Perfumery Laboratory |
| INDOLENE 50 Odor: Inol, jasmine with fecal note |
| Robertet |
| Schiff indol hydroxy 50 rh Odor: Floral, white flower, sweet |
| Seasons and Harvest / Crop calendar |
| Taytonn ASCC |
| Indolene 50 Odor: Animalic/ Animal, Floral |
| The John D. Walsh Company |
| Indolene 50 |
| The Perfumers Apprentice |
| Indolene 50 (I) Odor: Floral, Jasmin, Animal Use: Modified animal, fecal note useful in floral absolute types. Increases the substantivity of a fragrance and provides fixation as well as floralcy. |
| Vigon International |
| Indolene 50% (Indole/Hydroxycitronellal Schiff Base) Odor: ANIMALISTIC, FLORAL WARM |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| Acute toxicity, Oral (Category 4), H302 Skin irritation (Category 2), H315 Skin sensitisation (Category 1), H317 Serious eye damage/eye irritation (Category 2A), H320 | |
| GHS Label elements, including precautionary statements | |
| Pictogram |  |
| Signal word | Warning |
| Hazard statement(s) | |
| H302 - Harmful if swallowed H315 - Causes skin irritation H317 - May cause an allergic skin reaction H320 - Causes eye irritation | |
| Precautionary statement(s) | |
| P102 - Keep out of reach of children. P103 - Read label before use P261 - Avoid breathing dust/fume/gas/mist/vapours/spray. P264 - Wash skin thouroughly after handling. P270 - Do not eat, drink or smoke when using this product. P280 - Wear protective gloves/protective clothing/eye protection/face protection. P301 + P312 - IF SWALLOWED: call a POISON CENTER or doctor/physician IF you feel unwell. P302 + P352 - IF ON SKIN: wash with plenty of soap and water. P330 - Rinse mouth. P337 + P313 - IF eye irritation persists: Get medical advice/attention. P501 - Dispose of contents/ container to an approved waste disposal plant. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for indolall usage levels up to: | |||
| 5.0000 % in the fragrance concentrate. | |||
| Recommendation for indolall flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):68908-82-7 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :163281 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:2 |
| 7-hydroxy-3,7-dimethyloctanal; 1H-indole |
| Chemidplus:0068908827 |
| 8,8-di(indol-1-yl)-2,6-dimethyloctan-2-ol |
| Chemidplus:067801369 |
| 7-hydroxy-3,7-dimethyloctanal; 1H-indole | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 68908-82-7 |
| Pubchem (cid): | 163281 |
| Pubchem (sid): | 135120206 |
| 8,8-di(indol-1-yl)-2,6-dimethyloctan-2-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 67801-36-9 |
| Pubchem (cid): | 106826 |
| Pubchem (sid): | 684048 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| not found in nature |
| 8,8-bis-(2,3- | dihydroindol)-2,6-dimethyl-2-octanol |
| 7- | hydroxy-3,7-dimethyl octanal /indole |
| 7- | hydroxy-3,7-dimethyloctanal- 1H-indole(1:1) |
| 7- | hydroxy-3,7-dimethyloctanal; 1H-indole |
| hydroxycitronellal indole condensation products | |
| hydroxycitronellal, indole condensation products | |
| 8,8-bis(1H- | indol-1-yl)-2,6-dimethyl-2-octanol |
| beta-1H- | indol-1-yl-alpha,alpha,epsilon-trimethyl-1H-indole-1-heptanol |
| indolall | |
| indolam 50 (IFF) | |
| indole hydroxycitronellal condensation products | |
| indole/ hydroxycitronellal schiff base | |
| indolene 50 (Givaudan) | |
| indolene 50% BB (IFF) | |
| indolene 50% DEP (IFF) | |
| indolyl trimethyl indole-1-heptanol | |
| gamma-1H- | indolyl-alpha,alpha,epslon-trimethyl-1H-indole-1-heptanol |
| indolyl-trimethylindole-1-heptanol | |
| octanal, 7-hydroxy-3,7-dimethyl-, reaction products with 1H-indole |
| None found yet. Try the PubMed Search. |
