| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 68603-42-9 |
| ECHA EC Number: | 271-657-0 |
| FDA UNII: | Search |
| Category: | processing aids |
| IUPAC Name: | cocamide DEA |
| InChI : | InChI=1/C8H6Cl2O3.C3Cl6O.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;4-2(5,6)1(10)3(7,8)9;1-3-2/h1-3H,4H2,(H,11,12);;3H,1-2H3 |
| Std.InChI: | InChI=1S/C8H6Cl2O3.C3Cl6O.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;4-2(5,6)1(10)3(7,8)9;1-3-2/h1-3H,4H2,(H,11,12);;3H,1-2H3 |
| InChIKey : | VSIOJDPUQMSMND-UHFFFAOYAP |
| Std.InChIKey: | VSIOJDPUQMSMND-UHFFFAOYSA-N |
| SMILES : | CNC.C1=CC(=C(C=C1Cl)Cl)OCC(=O)O.C(=O)(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| Appearance: | pale yellow to amber yellow liquid to solid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Soluble in: | |
| water | |
| water, 49.91 mg/L @ 25 °C (est) | |
| Achiewell |
| For experimental / research use only. |
| Coco Fatty Diethanol Amide (CDEA) |
| Alzo International |
| Foamid C |
| Alzo International |
| Foamid G-65 |
| Alzo International |
| Foamid SCE |
| Alzo International |
| Foamul C |
| BOC Sciences |
| For experimental / research use only. |
| Amides, coco, N,N-bis(hydroxyethyl) |
| Covalent Chemical |
| cocamide DEA |
| ECSA Chemicals |
| COCAMIDE DEA |
| ECSA TRADE THE MOST UPDATED FINANCIAL PUBLICATION ON THE WORLD OF CHEMISTRY |
| Galaxy Surfactants |
| Galaxy 111 |
| Graham Chemical |
| Cocamide Dea (Performer Alkanolamide G200) |
| Graham Chemical |
| Coconut DEA Modified (Performer Alkanolamide G212) |
| Graham Chemical |
| Low Glycerine Cocamide DEA (Performer Alkanolamide G201) |
| Kao Corporation |
| AMIDET B-112 Odor: characteristic Use: Re-fatting skin effect. Other properties: anti-static, anticorrosion and wetting agent. Used as thickener in personal hygiene products, dishwashing . Contains Glycerin |
| Kao Corporation |
| AMIDET KDE Odor: characteristic Use: Re-fatting skin effect. Other properties: anti-static, anticorrosion and wetting agent. Used as thickener in personal hygiene products, dishwashing. Contains Glycerin |
| Kao Corporation |
| AMIDET SB-13 Odor: characteristic Use: Re-fatting skin effect. Other properties: anti-static, anticorrosion and wetting agent. Used as thickener in personal hygiene products |
| Kraft Chemical |
| Cocamide DEA |
| Krunal Group |
| Airsurf CDE |
| Lubrizol Corporation |
| Amidex™ BC-24 Surfactant Odor: characteristic Use: Amidex™ BC-24 surfactant is a unique liquid version of Cocamide MEA that also contains Cocamidopropyl Betaine. It allows formulators to blend the usually solid Cocamide MEA without the need for heating.Amidex BC-24 surfactant also adds the foam boosting and foam stabilizing properties of the Betaine in a single, easy-to-handle blend.Excellent foam and viscosity building with anionics suggest uses in shampoos, bubble baths, liquid soaps, conditioners and skin cleansers. |
| Lubrizol Corporation |
| Amidex™ C-CM Surfactant Odor: characteristic Use: Unique liquid version of Cocamide MEA that also contains Cocamidopropyl Betaine. Allows formulators to cold blend the usually solid Cocamide MEA. Amidex?6?4 C-CM Surfactant also adds the foam boosting and foam stabilizing properties of the Betaine. Excellent foam and viscosity building with anionics suggest uses in shampoos, bubble baths, liquid soaps, conditioners and skin cleansers. |
| Lubrizol Corporation |
| Amidex™ CE Surfactant Odor: characteristic Use: Amidex™ CE is an all-purpose, economical thickener and viscosity builder for cosmetic surfactant systems. |
| Lubrizol Corporation |
| Amidex™ CME Surfactant Odor: characteristic Use: Amidex™ CME is a rapid viscosity builder and foam enhancer.Effective in soap systems, synthetic powder detergents, bath products, skin cleaners, and liquid dish formulations. Builds foam and adds stability to formulations with tight, dense foam. |
| Lubrizol Corporation |
| Amidex™ KD Surfactant Odor: characteristic Use: Amidex™ KD is the amide of choice in ethoxy sulfate systems.Yields high, stable viscosities at low concentrations. Exhibits excellent flash foaming and foam stability. Used extensively for gelled shampoos, bath gels, liquid soaps and facial cleansers. |
| Lubrizol Corporation |
| Amidex™ KDO Surfactant Odor: characteristic Use: Amidex™ KDO is a cost-effective version of Amidex™ KD, building high viscosities and exhibiting good flash foaming and foam stability.Economical and effective in shampoos, bath and cleansing products. |
| Mohini Organics |
| MONEMIDE ® - CD (Super Amide) Odor: characteristic Use: MONEMIDE ® - CD (Super Amide) is used as a foam booster for shampoos, additive in synthetic lubricants, viscosity modifier, conditioner, emulsifier, wetting agent, penetrant, dye dispersant scouring aid, antistat, metal processing etc. |
| Mohini Organics |
| MONEMIDE™ - CD Odor: characteristic Use: MONEMIDE™ - CD is used as a foam booster for shampoos, additive in synthetic lubricants, viscosity modifier, conditioner, emulsifier, wetting agent, penetrant, dye dispersant scouring aid, antistat, metal processing etc.CDA is soluble in water and is used in manufacture of liquid detergents It is advantageously used in various cosmetics preparations namely shampoo, hair oils as a foam booster, stabilizer, thickening agent & wetting agent. Other uses of CDA are in textile scouring, leveling, cleaning, lubricating agents, metal anti-corrosives, pigments dispersants and perfume carrier, latex stabilizer. |
| Norman, Fox & Co. |
| 1:1 COCAMIDE DEA |
| OQEMA |
| LanCos CDEA |
| Penta International |
| COCAMIDE DIETHANOLAMINE (DEA) |
| Stepan Company |
| BIO-SOFT® LD-6 |
| Stepan Company |
| NINOL® 11-CM |
| Stepan Company |
| NINOL® 40-CO |
| Stepan Company |
| NINOL® 40CO-E |
| Stepan Company |
| NINOL® 49-CE |
| Zschimmer & Schwarz |
| Mulsifan CDEA21 |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| oral-rat LD50 12.40 ml/kg Journal of the American College of Toxicology. Vol. 5(5), Pg. 415, 1986. oral-rat LD50 12400 uL/kg Journal of the American College of Toxicology. Vol. 5(5), Pg. 415, 1986. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| processing aids | |||
| Recommendation for cocamide DEA usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for cocamide DEA flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| Chemical Carcinogenesis Research Information System:Search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):68603-42-9 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :75492608 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:2 |
| 2-(2,4-dichlorophenoxy)acetic acid;1,1,1,3,3,3-hexachloropropan-2-one;N-methylmethanamine |
| Chemidplus:0068603429 |
| EPA/NOAA CAMEO:hazardous materials |
| 2-(2,4-dichlorophenoxy)acetic acid;1,1,1,3,3,3-hexachloropropan-2-one;N-methylmethanamine | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 68603-42-9 |
| Pubchem (cid): | 75492608 |
| Pubchem (sid): | 135323658 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| FDA Indirect Additives used in Food Contact Substances: | View |
| HMDB (The Human Metabolome Database): | Search |
| FooDB: | FDB008909 |
| FDA Listing of Food Additive Status: | View |
| None Found |
| emulsifying agents | |
| emulsion stabilisers | |
| surfactants | |
| viscosity controlling agents |
| not found in nature |
| agent 565-14RC | |
| alkamide 2104 | |
| alkamide CDE | |
| alkamide DC 212S | |
| alkanolamide of coconut oil fatty acids and diethanolamine | |
| amides, coco, N,N-bis(2-hydroxyethyl) | |
| amides, coco, N,N-bis(hydroxyethyl) | |
| amides, N,N-bis(hydroxyethyl) coco | |
| amidet B 112 | |
| aminol HCA | |
| amisol CD | |
| arcalon 12 | |
| calamide C | |
| calimide C | |
| carsamide CA | |
| cedemide CX | |
| cedemide DX | |
| clindrol 200CGN | |
| cocamide diethanolamine | |
| cocamides diethanolamines | |
| ( | coco alkyl) diethanol amides |
| coco diethanolamides | |
| coconut acid, diethanolamide | |
| coconut DEA | |
| coconut diethanolamide | |
| coconut fatty acid amide of diethanolamine | |
| coconut fatty acid diethanolamine condensate | |
| coconut fatty acids diethanolamide | |
| coconut oil acid DEA | |
| coconut oil acid diethanol amine condensate | |
| coconut oil acid, diethanolamide | |
| coconut oil acids diethanolamide | |
| coconut oil acids, diethanolamide | |
| coconut oil acids, diethanolamine condensate | |
| coconut oil amide, N,N-bis(2-hydroxyethyl)- | |
| coconut oil diethanolamide | |
| coconut oil fatty acid diethanolamide | |
| coconut oil fatty acid, diethanolamide | |
| coconut oil fatty acids diethanolamide | |
| coconut oil fatty acids, diethanolamide | |
| coconut oil, diethanolamide | |
| cocoyl diethanol amide | |
| comperlan KD | |
| comperlan LS | |
| comperlan PD | |
| conco Emulsifier K | |
| crillon CDY | |
| cyclomide CD | |
| 2-(2,4- | dichlorophenoxy)acetic acid;1,1,1,3,3,3-hexachloropropan-2-one;N-methylmethanamine |
| diethanolamine, coconut fatty acids condensate | |
| empilan 2502 | |
| empilan CDE | |
| ethylan A 15 | |
| ethylan LD | |
| foamid C | |
| foamole 2AC | |
| homelead CD | |
| N,N-bis( | hydroxyethyl coco amides |
| N,N-bis( | hydroxyethyl) coco amide |
| N,N-bis( | hydroxyethyl) cocoamides |
| N,N-bis(2- | hydroxyethyl) coconut oil amide |
| N,N-bis(2- | hydroxyethyl)cocoamide |
| N,N-bis(2- | hydroxyethyl)coconut fatty acid amide |
| N,N-bis(2- | hydroxyethyl)coconut oil amide |
| laurel SD-950 | |
| lauridit KDG | |
| marlamid D 1218 | |
| mazamide 80 | |
| monamid 150AD | |
| monamid 150DR | |
| monamid ADD | |
| monolube 29-78 | |
| naxonol CO | |
| naxonol M 66 | |
| naxonol RN 66 | |
| ninol 2012E | |
| ninol 40-CO | |
| ninol 49-CE | |
| norfox KD | |
| schercomide ccd | |
| ufacid KD-S | |
| unamide D-10 |
