| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 67701-26-2 |
| ECHA EC Number: | 266-944-2 |
| FDA UNII: | Search |
| Category: | cosmetic agents |
| IUPAC Name: | C12-18-acid triglyceride |
| InChI : | InChI=1/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3 |
| Std.InChI: | InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3 |
| InChIKey : | ARIWANIATODDMH-UHFFFAOYAD |
| Std.InChIKey: | ARIWANIATODDMH-UHFFFAOYSA-N |
| SMILES : | O=C(OCC(O)CO)CCCCCCCCCCC |
| Molar Refractivity : | 76.34 ± 0.3 cm3 (est) |
| Parachor : | 684.4 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.467 ± 0.02 (est) |
| Surface Tension : | 38.3 ± 3.0 dyne/cm (est) |
| Density : | 0.997 ± 0.06 g/cm3 (est) |
| Polarizability : | 30.26 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 397.44 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 276.00 °F. TCC ( 135.60 °C. ) (est) |
| logP (o/w): | 4.029 (est) |
| Soluble in: | |
| alcohol | |
| water, 9.596e-015 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| ABITEC |
| Acconon C-44 EP/NF |
| ABITEC |
| Acconon C-44 |
| BOC Sciences |
| For experimental / research use only. |
| Glycerides, C12-18 |
| Indis NV |
| For experimental / research use only. |
| Witepsol (Various types) |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| cosmetic agents | |||
| Recommendation for C12-18-acid triglyceride usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for C12-18-acid triglyceride flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):67701-26-2 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :14871 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:nwg |
| 2,3-dihydroxypropyl dodecanoate (C12-18) |
| Chemidplus:0067701262 |
| 2,3-dihydroxypropyl dodecanoate (C12-18) | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 67701-26-2 |
| Pubchem (cid): | 14871 |
| Pubchem (sid): | 135048258 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| emollients | |
| emulsifying agents |
| not found in nature |
| acconon C-44 | |
| acconon C-44 EP/NF | |
| aldo MLD | |
| (±)-2,3- | dihydroxypropyl dodecanoate (C12-18) |
| 2,3- | dihydroxypropyl dodecanoate (C12-18) |
| 2,3- | dihydroxypropyl laurate (C12-18) |
| dodecanoic acid 2,3-dihydroxypropyl ester (C12-18) | |
| dodecanoic acid a-monoglyceride (C12-18) | |
| dodecanoic acid, 2,3-dihydroxypropyl ester (C12-18) | |
| dodecanoic acid, monoester with 1,2,3-propanetriol (C12-18) | |
| 1-mono | dodecanoyl-rac-glycerol (C12-18) |
| glycerides, C12-18 | |
| lauric acid monoglyceride (C12-18) | |
| lauric acid, monoester with glycerol (C12-18) | |
| monomuls 90l12 | |
| sunsoft 757 | |
| tegin L 90 |
| None found yet. Try the PubMed Search. |
