| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 6414-32-0 |
| ECHA EC Number: | 229-117-7 |
| FDA UNII: | XD1E01A8JR |
| Category: | flavor and fragrance agents |
| IUPAC Name: | anisaldehyde propylene glycol acetal |
| InChI : | InChI=1/C11H14O3/c1-8-7-13-11(14-8)9-3-5-10(12-2)6-4-9/h3-6,8,11H,7H2,1-2H3 |
| Std.InChI: | InChI=1S/C11H14O3/c1-8-7-13-11(14-8)9-3-5-10(12-2)6-4-9/h3-6,8,11H,7H2,1-2H3 |
| InChIKey : | DTACWEXJFYOAKS-UHFFFAOYAU |
| Std.InChIKey: | DTACWEXJFYOAKS-UHFFFAOYSA-N |
| SMILES : | CC1COC(O1)C2=CC=C(C=C2)OC |
| Molar Refractivity : | 52.87 ± 0.3 cm3 (est) |
| Parachor : | 438.7 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.502 ± 0.02 (est) |
| Surface Tension : | 36.1 ± 3.0 dyne/cm (est) |
| Density : | 1.085 ± 0.06 g/cm3 (est) |
| Polarizability : | 20.96 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| FEMA Number: | 4627 anisaldehyde propyleneglycol acetal |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 6414-32-0 ; ANISALDEHYDE PROPYLENEGLYCOL ACETAL |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for anisaldehyde propylene glycol acetal usage levels up to: | |||
| 3.0000 % in the fragrance concentrate. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 24 | |||
| Click here to view publication 24 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | - | |
| beverages(nonalcoholic): | 0.20000 | 5.00000 | |
| beverages(alcoholic): | - | - | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | - | - | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | 1.00000 | 10.00000 | |
| fruit ices: | - | - | |
| gelatins / puddings: | - | - | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | 1.00000 | 20.00000 | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :98081 |
| National Institute of Allergy and Infectious Diseases:Data |
| 2-(4-methoxyphenyl)-4-methyl-1,3-dioxolane |
| Chemidplus:0006414320 |
| 2-(4-methoxyphenyl)-4-methyl-1,3-dioxolane | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 6414-32-0 |
| Pubchem (cid): | 98081 |
| Pubchem (sid): | 135055255 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| p- | anisaldehyde propylene glycol acetal |
| anisaldehyde propyleneglycol acetal | |
| 1,3- | dioxolane, 2-(4-methoxyphenyl)-4-methyl- |
| 1,3- | dioxolane,2-(4-methoxyphenyl)-4-methyl- |
| 2-(4- | methoxyphenyl)-4-methyl-1,3-dioxolane |
| 2-(p- | methoxyphenyl)-4-methyl-1,3-dioxolane |
| 2-(para- | methoxyphenyl)-4-methyl-1,3-dioxolane |
| None found yet. Try the PubMed Search. |
