| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 63279-14-1 |
| FDA UNII: | 693TGS3OHR |
| Category: | sweeteners, flavor enhancers |
| IUPAC Name: | rebaudioside E |
| InChI : | InChI=1/C44H70O23/c1-17-11-43-9-5-22-41(2,7-4-8-42(22,3)40(59)66-38-34(30(55)26(51)20(14-47)62-38)64-36-32(57)28(53)24(49)18(12-45)60-36)23(43)6-10-44(17,16-43)67-39-35(31(56)27(52)21(15-48)63-39)65-37-33(58)29(54)25(50)19(13-46)61-37/h18-39,45-58H,1,4-16H2,2-3H3/t18-,19-,20-,21-,22+,23+,24-,25-,26-,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37+,38+,39+,41-,42-,43-,44+/m1/s1 |
| Std.InChI: | InChI=1S/C44H70O23/c1-17-11-43-9-5-22-41(2,7-4-8-42(22,3)40(59)66-38-34(30(55)26(51)20(14-47)62-38)64-36-32(57)28(53)24(49)18(12-45)60-36)23(43)6-10-44(17,16-43)67-39-35(31(56)27(52)21(15-48)63-39)65-37-33(58)29(54)25(50)19(13-46)61-37/h18-39,45-58H,1,4-16H2,2-3H3/t18-,19-,20-,21-,22+,23+,24-,25-,26-,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37+,38+,39+,41-,42-,43-,44+/m1/s1 |
| InChIKey : | RLLCWNUIHGPAJY-SFUUMPFEBA |
| Std.InChIKey: | RLLCWNUIHGPAJY-SFUUMPFESA-N |
| SMILES : | C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2CC[C@](C3)(C(=C)C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)(C)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O |
| Molar Refractivity : | 224.08 ± 0.4 cm3 (est) |
| Parachor : | 1888.8 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.658 ± 0.03 (est) |
| Surface Tension : | 93.2 ± 5.0 dyne/cm (est) |
| Density : | 1.59 ± 0.1 g/cm3 (est) |
| Polarizability : | 88.83 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| FDA/DG SANTE Petitions, Reviews, Notices: | |
| GRN 823 | Rebaudioside E View - notice PDF |
| FEMA Number: | 4936 rebaudioside E |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| Rebaudioside E |
| Carbosynth |
| For experimental / research use only. |
| Rebaudioside E |
| Sigma-Aldrich |
| For experimental / research use only. |
| Rebaudioside E ≥90.0% (HPLC) |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| sweeteners, flavor enhancers | |||
| Recommendation for rebaudioside E usage levels up to: | |||
| not for fragrance use. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 29 | |||
| Click here to view publication 29 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | 30.00000 | 45.00000 | |
| beverages(nonalcoholic): | 30.00000 | 45.00000 | |
| beverages(alcoholic): | 30.00000 | 45.00000 | |
| breakfast cereal: | 30.00000 | 45.00000 | |
| cheese: | - | - | |
| chewing gum: | 35.00000 | 45.00000 | |
| condiments / relishes: | 30.00000 | 45.00000 | |
| confectionery froastings: | 30.00000 | 45.00000 | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | 30.00000 | 45.00000 | |
| fruit ices: | 30.00000 | 45.00000 | |
| gelatins / puddings: | 30.00000 | 45.00000 | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | 30.00000 | 45.00000 | |
| imitation dairy: | 30.00000 | 45.00000 | |
| instant coffee / tea: | 30.00000 | 45.00000 | |
| jams / jellies: | 30.00000 | 45.00000 | |
| meat products: | - | - | |
| milk products: | 30.00000 | 45.00000 | |
| nut products: | 30.00000 | 45.00000 | |
| other grains: | 30.00000 | 45.00000 | |
| poultry: | - | - | |
| processed fruits: | 30.00000 | 45.00000 | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | 30.00000 | 45.00000 | |
| snack foods: | 30.00000 | 45.00000 | |
| soft candy: | 30.00000 | 45.00000 | |
| soups: | 30.00000 | 45.00000 | |
| sugar substitutes: | - | - | |
| sweet sauces: | 30.00000 | 45.00000 | |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :72710721 |
| National Institute of Allergy and Infectious Diseases:Data |
| Chemidplus:0063279141 |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 72710721 |
| Pubchem (cas): | 63279-14-1 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| HMDB (The Human Metabolome Database): | HMDB34946 |
| FooDB: | FDB013539 |
| FDA Listing of Food Additive Status: | View |
| VCF-Online: | VCF Volatile Compounds in Food |
| None Found |
| None Found |
| kaur-16-en-18-oic acid, 13-((2-o-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy)-, 2-o-beta-D-glucopyranosyl-beta-D-glucopyranosyl ester, (4alpha)- |
