| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 628-63-7 |
| ECHA EC Number: | 211-047-3 |
| FDA UNII: | 92Q24NH7AS |
| CoE Number: | 211 |
| Category: | flavor and fragrance agents, carrier solvents |
| IUPAC Name: | amyl acetate |
| InChI : | InChI=1/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
| Std.InChI: | InChI=1S/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
| InChIKey : | PGMYKACGEOXYJE-UHFFFAOYAQ |
| Std.InChIKey: | PGMYKACGEOXYJE-UHFFFAOYSA-N |
| SMILES : | CCCCCOC(=O)C |
| MDL: | MFCD00009500 |
| Molar Refractivity : | 36.25 ± 0.3 cm3 (est) |
| Parachor : | 335.3 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.406 ± 0.02 (est) |
| Surface Tension : | 26.6 ± 3.0 dyne/cm (est) |
| Density : | 0.882 ± 0.06 g/cm3 (est) |
| Polarizability : | 14.37 ± 0.5 10-24cm3 (est) |
| Fragrance Demo Formulas | |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| DG SANTE Food Flavourings: | 09.021 pentyl acetate |
| FDA Mainterm (IAUFC): | 628-63-7 ; AMYL ACETATE |
| Appearance: | colorless clear liquid (est) |
| Assay: | 99.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.87500 to 0.87900 @ 20.00 °C. |
| Pounds per Gallon - (est).: | 7.289 to 7.323 |
| Refractive Index: | 1.40000 to 1.40500 @ 20.00 °C. |
| Melting Point: | -100.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 149.00 to 150.00 °C. @ 760.00 mm Hg |
| Vapor Pressure: | 3.500000 mmHg @ 25.00 °C. |
| Vapor Density: | 4.5 ( Air = 1 ) |
| Flash Point: | 75.00 °F. TCC ( 23.89 °C. ) |
| logP (o/w): | 2.300 |
| Soluble in: | |
| alcohol | |
| water, 1700 mg/L @ 20 °C (exp) | |
| Similar Items:note | |
| isoamyl acetate | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | fragrance solvents |
| Preferred SDS: View | |
| European information : | |
| Most important hazard(s): | |
| Xi - Irritant | |
| R 10 - Flammable. R 66 - Repeated exposure may cause skin dryness or cracking. S 02 - Keep out of the reach of children. S 16 - Keep away from sources of ignition - No Smoking. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| oral-rat LD50 > 1600 mg/kg National Technical Information Service. Vol. OTS0556694 oral-rabbit LD50 7400 mg/kg "Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 357, 1986. intraperitoneal-guinea pig LDLo 1500 mg/kg American Industrial Hygiene Association Journal. Vol. 35, Pg. 21, 1974. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| inhalation-human TCLo 5000 mg/m3/30M SENSE ORGANS AND SPECIAL SENSES: CONJUNCTIVE IRRITATION: EYEBEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)LUNGS, THORAX, OR RESPIRATION: OTHER CHANGES Archiv fuer Hygiene. Vol. 78, Pg. 260, 1913. inhalation-rat LC > 3000 ppm/6H National Technical Information Service. Vol. OTS0558878 | |
| Category: | |||
| flavor and fragrance agents, carrier solvents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for amyl acetate usage levels up to: | |||
| 8.0000 % in the fragrance concentrate. | |||
| EPI System: View |
| NIOSH International Chemical Safety Cards:search |
| NIOSH Pocket Guide:search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):628-63-7 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :12348 |
| National Institute of Allergy and Infectious Diseases:Data |
| WISER:UN 1104 |
| WGK Germany:1 |
| pentyl acetate |
| Chemidplus:0000628637 |
| EPA/NOAA CAMEO:hazardous materials |
| RTECS:628-63-7 |
| pentyl acetate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 628-63-7 |
| Pubchem (cid): | 12348 |
| Pubchem (sid): | 134976020 |
| Pherobase: | View |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Indirect Additives used in Food Contact Substances: | View |
| CHEBI: | View |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | HMDB39095 |
| FooDB: | FDB018599 |
| Export Tariff Code: | 2915.39.9000 |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| Wikipedia: | View |
| Formulations/Preparations: •grades: commercial (85-88%), high test (85-88%), technical (90-95%), pure (95-99%); special antibiotic grade. amyl acetate is also sold by original source, as from fusel oil, pentane, or oxo process.•commercial amyl acetate is a mixture of isomers, the composition and properties depending upon the grade and derivation. the principal isomers are isoamyl, normal, and secondary amyl acetates. | |
| FR | almond |
| FR | apple |
| FR | apple red apple |
| FR | apricot |
| FR | banana |
| FR | blackberry |
| FR | blueberry |
| FL | brandy |
| FR | bubble gum |
| FR | butterscotch |
| FR | carnation |
| FR | cherry |
| FL | chocolate cocoa |
| FR | coconut |
| FR | coffee |
| FR | crabapple blossom |
| FR | cranberry |
| FR | currant |
| FR | date |
| FR | floral |
| FR | fruit |
| FR | fruit juicy fruit |
| FR | gooseberry |
| FR | grape |
| FL | grenadine |
| FR | hibiscus |
| FR | honey |
| FR | hop |
| FR | huckleberry |
| FR | hyacinth |
| FR | lemon |
| FR | lily of the valley |
| FR | lime |
| FR | melon |
| FR | mint |
| FR | mulberry |
| FR | orange |
| FR | oriental |
| FR | passion fruit |
| FR | peach |
| FR | pear |
| FR | pina colada |
| FR | pineapple |
| FL | pistachio |
| FR | plum |
| FR | quince |
| FR | raspberry |
| FR | rose |
| FR | strawberry |
| FR | tangerine |
| FL/FR | valerian |
| FR | vanilla |
| FR | violet |
| apple fruit Search Trop Picture | |
| apple juice Search PMC Picture | |
| banana fruit Search Trop Picture | |
| bay laurel leaf Search Trop Picture | |
| beer Search PMC Picture | |
| butter Search PMC Picture | |
| cacao bean Search Trop Picture | |
| malus sieversii PbMd Search Trop Picture | |
| papaya fruit Search Trop Picture | |
| peach fruit Search Trop Picture | |
| plum fruit Search Trop Picture | |
| strawberry wild strawberry fruit Search Trop Picture |
| acetate C-5 | |
| acetic acid amyl ester | |
| acetic acid N-pentyl ester | |
| acetic acid pentyl ester | |
| acetic acid, amyl ester | |
| acetic acid, pentyl ester | |
| N- | amyl acetate |
| N | amyl acetate |
| amyl acetate FCC | |
| amyl acetate normal | |
| amyl acetate primary | |
| amyl acetate primary FCC | |
| amyl acetate USP | |
| amyl acetic ester | |
| amyl-acetate (n-amyl-acetate) | |
| amylacetate | |
| birnenoel | |
| dymon swh wasp & hornet spray | |
| holiday pet repellent | |
| pentanol acetate | |
| 1- | pentanol acetate |
| 1- | pentanol, acetate |
| pentyl acetate | |
| 1- | pentyl acetate |
| N- | pentyl acetate |
| pentyl ester of acetic acid | |
| pentyl ethanoate | |
| N- | pentyl ethanoate |
| primary amyl acetate |
