| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 621-70-5 |
| ECHA EC Number: | 210-701-5 |
| FDA UNII: | EZ1Y9R895Y |
| Category: | solvents |
| IUPAC Name: | tricaproin |
| InChI : | InChI=1/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 |
| Std.InChI: | InChI=1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 |
| InChIKey : | MAYCICSNZYXLHB-UHFFFAOYAR |
| Std.InChIKey: | MAYCICSNZYXLHB-UHFFFAOYSA-N |
| SMILES : | CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC |
| MDL: | MFCD00042905 |
| Molar Refractivity : | 104.62 ± 0.3 cm3 (est) |
| Parachor : | 939.2 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.454 ± 0.02 (est) |
| Surface Tension : | 35.0 ± 3.0 dyne/cm (est) |
| Density : | 1.001 ± 0.06 g/cm3 (est) |
| Polarizability : | 41.47 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Melting Point: | -60.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 244.00 °C. @ 28.00 mm Hg |
| Boiling Point: | 429.00 to 430.00 °C. @ 490.00 mm Hg (est) |
| Flash Point: | 356.00 °F. TCC ( 180.20 °C. ) (est) |
| logP (o/w): | 6.330 (est) |
| Soluble in: | |
| water, 0.45 mg/L @ 37 °C (exp) | |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| TRIHEXANOIN >95.0%(GC) |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Glycerol trihexanoate |
| Sigma-Aldrich: Sigma |
| For experimental / research use only. |
| Glycerol trihexanoate ∼99% |
| TCI AMERICA |
| For experimental / research use only. |
| Tricaproin >95.0%(GC) |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| intravenous-mouse LD50 122 mg/kg LUNGS, THORAX, OR RESPIRATION: RESPIRATORY DEPRESSIONBEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD Acta Physiologica Scandinavica. Vol. 40, Pg. 338, 1957. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| solvents | |||
| Recommendation for tricaproin usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for tricaproin flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):621-70-5 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :12131 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:1 |
| 2,3-di(hexanoyloxy)propyl hexanoate |
| Chemidplus:0000621705 |
| RTECS:MB2700000 for cas# 621-70-5 |
| 2,3-di(hexanoyloxy)propyl hexanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 12131 |
| Pubchem (sid): | 134976399 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| HMDB (The Human Metabolome Database): | HMDB31125 |
| FooDB: | FDB003136 |
| Export Tariff Code: | 2940.00.6000 |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| None Found |
| not found in nature |
| caproic triglyceride | |
| 1,3- | di(hexanoyloxy)propan-2-yl hexanoate |
| 2,3- | di(hexanoyloxy)propyl hexanoate |
| glycerol tricaproate | |
| glycerol tricapronate | |
| glycerol trihexanoate | |
| glyceryl tricaproate | |
| hexanoic acid 1,2,3-propane triyl ester | |
| hexanoic acid, 1,2,3-propanetriyl ester | |
| hexanoin, tri- (6CI,7CI,8CI) | |
| 2- | hexanoyloxy-1-(hexanoyloxymethyl)ethyl hexanoate |
| palmitic acid triglyceride | |
| propane-1,2,3-triyl trihexanoate | |
| 1,2,3- | propanetriyl trihexanoate |
| tri-N-caproin | |
| tricapronin | |
| tricaproyl glycerol | |
| tricaproylglycerol | |
| 1,2,3- | tricaproylglycerol |
| trihexanoin | |
| trihexanoyl glycerol | |
| trihexanoylglycerol |
