| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 53824-77-4 |
| ECHA EC Number: | 258-814-9 |
| FDA UNII: | U783H9JHWY |
| Category: | emollients |
| IUPAC Name: | propylene glycol dicaprate |
| InChI : | InChI=1/C23H44O4/c1-4-6-8-10-12-14-16-18-22(24)26-20-21(3)27-23(25)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3 |
| Std.InChI: | InChI=1S/C23H44O4/c1-4-6-8-10-12-14-16-18-22(24)26-20-21(3)27-23(25)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3 |
| InChIKey : | NFIHXTUNNGIYRF-UHFFFAOYAW |
| Std.InChIKey: | NFIHXTUNNGIYRF-UHFFFAOYSA-N |
| SMILES : | CCCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCCC |
| Molar Refractivity : | 112.11 ± 0.3 cm3 (est) |
| Parachor : | 994.0 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.452 ± 0.02 (est) |
| Surface Tension : | 32.7 ± 3.0 dyne/cm (est) |
| Density : | 0.925 ± 0.06 g/cm3 (est) |
| Polarizability : | 44.44 ± 0.5 10-24cm3 (est) |
| Assay: | 97.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 452.00 to 454.00 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 412.00 °F. TCC ( 211.00 °C. ) (est) |
| logP (o/w): | 8.726 (est) |
| Soluble in: | |
| water, 0.0001474 mg/L @ 25 °C (est) | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | skin conditioning - emollient |
| ABITEC |
| Captex 100 |
| Chemical-navi - Nikkol |
| NIKKOL PDD Odor: characteristic Use: Low viscosity; light feel |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| emollients | |||
| Recommendation for propylene glycol dicaprate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for propylene glycol dicaprate flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):53824-77-4 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :103849 |
| National Institute of Allergy and Infectious Diseases:Data |
| 2-decanoyloxypropyl decanoate |
| Chemidplus:0053824774 |
| 2-decanoyloxypropyl decanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 53824-77-4 |
| Pubchem (cid): | 103849 |
| Pubchem (sid): | 135061430 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| captex 100 | |
| decanoic acid 1-methyl-1,2-ethane diyl ester | |
| decanoic acid 1-methyl-1,2-ethanediyl ester | |
| 2- | decanoyloxypropyl decanoate |
| nikkol PDD | |
| 1,2- | propane diol didecanoate |
| propylene didecanoate | |
| 1,2- | propylene glycol didecanoate |
