| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 5333-42-6 |
| ECHA EC Number: | 226-242-9 |
| FDA UNII: | 461N1O614Y |
| Category: | cosmetic and fragrance agents |
| IUPAC Name: | octyl dodecanol |
| InChI : | InChI=1/C20H42O/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| Std.InChI: | InChI=1S/C20H42O/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey : | LEACJMVNYZDSKR-UHFFFAOYAW |
| Std.InChIKey: | LEACJMVNYZDSKR-UHFFFAOYSA-N |
| SMILES : | CCCCCCCCCCC(CCCCCCCC)CO |
| MDL: | MFCD01310428 |
| Molar Refractivity : | 96.19 ± 0.3 cm3 (est) |
| Parachor : | 841.9 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.452 ± 0.02 (est) |
| Surface Tension : | 31.0 ± 3.0 dyne/cm (est) |
| Density : | 0.837 ± 0.06 g/cm3 (est) |
| Polarizability : | 38.13 ± 0.5 10-24cm3 (est) |
| Assay: | 97.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Melting Point: | -1.00 °C. @ 760.00 mm Hg (est) |
| Boiling Point: | 234.00 to 238.00 °C. @ 33.00 mm Hg |
| Vapor Pressure: | 0.000001 mmHg @ 25.00 °C. (est) |
| Flash Point: | 235.00 °F. TCC ( 113.00 °C. ) |
| logP (o/w): | 8.834 (est) |
| Soluble in: | |
| alcohol | |
| water, 0.001745 mg/L @ 25 °C (est) | |
| Alzo International |
| Dermocol I-20 |
| BOC Sciences |
| For experimental / research use only. |
| 2-oCtyl-1-dodecanol |
| Diffusions Aromatiques |
| 2-OCTYLDODECANOL |
| ECSA Chemicals |
| ELCOOL 20-A |
| ECSA TRADE THE MOST UPDATED FINANCIAL PUBLICATION ON THE WORLD OF CHEMISTRY |
| Jarchem Industries |
| Jarcol™ I-20 Odor: characteristic Use: is an excellent base alcohol for esterification, ethoxylation, propoxylation, and other reaction chemistries. It\\\\\\\\\\\\\\\'s extremely low melt point (0 degrees c) makes it much easier to work with than even lower molecular weight linear alcohols. This results in down stream products with unique functional characteristics. JARCOL I-20 is synthetically derived providing essentially pure material with reduced side reaction impurities. |
| Jarchem Industries |
| Jarcol™ I-20CG Odor: characteristic Use: An excellent base alcohol and emollient. It's extremely low melt point (0 degrees C) makes it much easier to work with than even lower molecular weight linear alcohols. Additionally the higher molecular weight and purity means that it is"water white" with no "fatty" odor and can be used in color and fragrance sensitive applications. |
| Jarchem Industries |
| Jarcol™ I-20P Odor: characteristic Use: 2-Octyldodecanol NF is manufactured with the strict quality procedures and documentation required by the pharmaceutical industry. |
| Jiangyin Healthway |
| 2-Octyl-1-Dodecanol |
| New functional food ingredients |
| Kao Corporation |
| KALCOL 200GD Odor: characteristic Use: Pharmaceuticals and Cosmetics use : Emulsion stabilizer for creams and lotions. Quality modifier of lipsticks. Additive for ointment base and cream conditioners. The smooth touch to skin for cosmetic uses. Auxiliary for emulsifiers. Thickening agent. |
| Kraft Chemical |
| Eutanol |
| Sigma-Aldrich: Aldrich |
| For experimental / research use only. |
| Octyl-1-dodecanol 97% |
| SysKem Chemie |
| Octyldodecanole |
| TCI AMERICA |
| For experimental / research use only. |
| 2-n-Octyl-1-dodecanol >90.0%(GC) |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| cosmetic and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for octyl dodecanol flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| Daily Med:search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):5333-42-6 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :21414 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:nwg |
| 2-octyldodecan-1-ol |
| Chemidplus:0005333426 |
| RTECS:JR4240000 for cas# 5333-42-6 |
| 2-octyldodecan-1-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 5333-42-6 |
| Pubchem (cid): | 21414 |
| Pubchem (sid): | 134985760 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEMBL: | View |
| KEGG (GenomeNet): | C20338 |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 2905.19.9090 |
| ChemSpider: | View |
| None Found |
| emollients | |
| solvents |
| not found in nature |
| dermocol I-20 | |
| 1- | dodecanol, 2-octyl- |
| eutanol | |
| eutanol G | |
| jarcol I-20 | |
| jarcol I-20CG | |
| jarcol I-20P | |
| kalcohl 200G | |
| kalcol 200GD | |
| 2- | octyl dodecan-1-ol |
| 2- | octyl dodecanol |
| 2- | octyl-1-dodecanol |
| 2- | octyldodecan-1-ol |
| 2- | octyldodecanol |
| 2- | octyldodecyl alcohol |
| rilanit G 20 | |
| standamul G |
