| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 52101-01-6 |
| ECHA EC Number: | 257-662-0 |
| FDA UNII: | Search |
| Category: | special dietary and nutritional additives |
| IUPAC Name: | magnesium dextro,leavo-aspartate |
| InChI : | InChI=1/C4H7NO4.Mg/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| Std.InChI: | InChI=1S/C4H7NO4.Mg/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey : | NFFJLMKHRCXLJO-NUQVWONBAP |
| Std.InChIKey: | NFFJLMKHRCXLJO-UHFFFAOYSA-L |
| SMILES : | [Mg+2].[O-]C(=O)CC(N)C([O-])=O |
| Appearance: | white powder (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 264.10 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.002890 mmHg @ 25.00 °C. (est) |
| Flash Point: | 236.00 °F. TCC ( 113.50 °C. ) (est) |
| logP (o/w): | -0.669 (est) |
| None found |
| Anhui Haibei |
| Magnesium DL-aspartate |
| BOC Sciences |
| For experimental / research use only. |
| magnesium DL-aspartate 95% |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| special dietary and nutritional additives | |||
| Recommendation for magnesium dextro,leavo-aspartate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for magnesium dextro,leavo-aspartate flavor usage levels up to: | |||
| not for flavor use. | |||
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :119638 |
| National Institute of Allergy and Infectious Diseases:Data |
| magnesium;2-aminobutanedioate |
| Chemidplus:0000062522 |
| magnesium;2-aminobutanedioate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 119638 |
| Pubchem (sid): | 135075332 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| FDA Listing of Food Additive Status: | View |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| (DL- | aspartato(2-))magnesium |
| [DL- | aspartato(2-)]magnesium |
| aspartic acid magnesium salt | |
| aspartic acid, magnesium salt | |
| aspartic acid, magnesium salt (1:1) | |
| DL- | asparticacidhemimagnesiumsalt |
| magnesium 2-aminobutanedioate | |
| magnesium 2-aminosuccinate | |
| magnesium DL-aspartate | |
| magnesium;2-aminobutanedioate |
