| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 497-15-4 |
| FDA UNII: | 5R0YG3SBR7 |
| Category: | information only not used for fragrances or flavors |
| IUPAC Name: | glucic acid |
| InChI : | InChI=1/C3H4O3/c4-1-3(6)2-5/h1-2,4,6H/b3-1+ |
| Std.InChI: | InChI=1S/C3H4O3/c4-1-3(6)2-5/h1-2,4,6H/b3-1+ |
| InChIKey : | NGSULTPMGQCSHK-HNQUOIGGBZ |
| Std.InChIKey: | NGSULTPMGQCSHK-HNQUOIGGSA-N |
| SMILES : | O=CC(/O)=C\O |
| Molar Refractivity : | 19.10 ± 0.3 cm3 (est) |
| Parachor : | 177.2 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.510 ± 0.02 (est) |
| Surface Tension : | 59.5 ± 3.0 dyne/cm (est) |
| Density : | 1.380 ± 0.06 g/cm3 (est) |
| Polarizability : | 7.57 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 274.01 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.001000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 273.00 °F. TCC ( 133.80 °C. ) (est) |
| logP (o/w): | -0.587 (est) |
| Soluble in: | |
| water, 1e+006 mg/L @ 25 °C (est) | |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| Hydroxypropanedial |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Hydroxypropanedial |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| information only not used for fragrances or flavors | |||
| Recommendation for glucic acid usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for glucic acid flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :3034155 |
| National Institute of Allergy and Infectious Diseases:Data |
| (E)-2,3-dihydroxyprop-2-enal |
| Chemidplus:0000497154 |
| (E)-2,3-dihydroxyprop-2-enal | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 3034155 |
| Pubchem (sid): | 135036091 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | HMDB40261 |
| FooDB: | FDB019978 |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| None Found |
| not found in nature |
| (E)-2,3- | dihydroxyprop-2-enal |
| glucose-reductone | |
| hydroxypropane dial | |
| hydroxypropanedial | |
| propanedial, hydroxy- (9CI) | |
| tartronal | |
| tartronaldehyde | |
| tartronic aldehyde | |
| triose reductone |
