| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 4630-07-3 |
| ECHA EC Number: | 225-047-6 |
| FDA UNII: | 96H21P91IG |
| CoE Number: | 11030 |
| Category: | flavoring agents |
| IUPAC Name: | valencene 80 extract |
| InChI : | InChI=1/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3 |
| Std.InChI: | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3 |
| InChIKey : | QEBNYNLSCGVZOH-UHFFFAOYAO |
| Std.InChIKey: | QEBNYNLSCGVZOH-UHFFFAOYSA-N |
| SMILES : | CC1CCC=C2C1(CC(CC2)C(=C)C)C |
| MDL: | MFCD00075884 |
| Molar Refractivity : | 66.59 ± 0.4 cm3 (est) |
| Parachor : | 533.3 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.494 ± 0.03 (est) |
| Surface Tension : | 29.7 ± 5.0 dyne/cm (est) |
| Density : | 0.89 ± 0.1 g/cm3 (est) |
| Polarizability : | 26.40 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| FEMA Number: | 4838 valencene 80 extract |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| Assay: | 80.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Soluble in: | |
| water, 0.05011 mg/L @ 25 °C (est) | |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavoring agents | |||
| Recommendation for valencene 80 extract usage levels up to: | |||
| not for fragrance use. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 28 | |||
| Click here to view publication 28 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | 0.90000 | |
| beverages(nonalcoholic): | - | 0.60000 | |
| beverages(alcoholic): | - | 0.90000 | |
| breakfast cereal: | - | 0.90000 | |
| cheese: | - | - | |
| chewing gum: | 20.00000 | 1000.00000 | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | 0.90000 | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | 0.90000 | |
| fruit ices: | - | - | |
| gelatins / puddings: | - | 0.90000 | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | - | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | 0.90000 | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):4630-07-3 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :288227 |
| National Institute of Allergy and Infectious Diseases:Data |
| 4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene (valencene 80 extract) |
| Chemidplus:0004630073 |
| 4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene (valencene 80 extract) | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 4630-07-3 |
| Pubchem (cid): | 288227 |
| Pubchem (sid): | 10523450 |
| Flavornet: | 4630-07-3 |
| Pherobase: | View |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| None Found |
| found in nature |
| 4a,5- | dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene (valencene 80 extract) |
| None found yet. Try the PubMed Search. |
