1-(alpha-furyl) propanol
information only not used for fragrances or flavors
| 2D: |
 |
| 3D: |
|
| CAS Number: |
4208-61-1
|
| ECHA EC Number: |
224-129-9 |
| FDA UNII: |
Q0TJ5Q05LN |
| Category: |
information only not used for fragrances or flavors |
| IUPAC Name: |
1-(alpha-furyl) propanol |
| InChI : |
InChI=1/C7H10O2/c1-2-6(8)7-4-3-5-9-7/h3-6,8H,2H2,1H3 |
| Std.InChI: |
InChI=1S/C7H10O2/c1-2-6(8)7-4-3-5-9-7/h3-6,8H,2H2,1H3 |
| InChIKey : |
MWXWHUXLVXOXBZ-UHFFFAOYAQ |
| Std.InChIKey: |
MWXWHUXLVXOXBZ-UHFFFAOYSA-N |
| SMILES : |
CCC(C1=CC=CO1)O |
| MDL: |
MFCD00072599 |
| Molar Refractivity : |
34.27 ± 0.3 cm3 (est) |
| Parachor : |
293.0 ± 4.0 cm3 (est) |
| Index of Refraction : |
1.483 ± 0.02 (est) |
| Surface Tension : |
35.7 ± 3.0 dyne/cm (est) |
| Density : |
1.052 ± 0.06 g/cm3 (est) |
| Polarizability : |
13.58 ± 0.5 10-24cm3 (est) |
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 157.00 to 158.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 1.944000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 120.00 °F. TCC ( 48.90 °C. ) (est) |
| logP (o/w): | 1.434 (est) |
| Soluble in: |
| | water, 2.149e+004 mg/L @ 25 °C (est) |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
| Not determined |
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
| Category: |
| information only not used for fragrances or flavors |
| Recommendation for 1-(alpha-furyl) propanol usage levels up to: |
| | not for fragrance use. |
| |
| Recommendation for 1-(alpha-furyl) propanol flavor usage levels up to: |
| | not for flavor use. |
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| alpha- | ethyl-2-furan methanol |
| a- | ethyl-2-furanmethanol |
| alpha- | ethyl-2-furanmethanol |
| 1-( | furan-2-yl) propan-1-ol |
| 1-( | furan-2-yl)propan-1-ol |
| 2- | furanmethanol, a-ethyl- |
| | furfuryl alcohol, a-ethyl- |
| 1-(2- | furyl)-1-propanol |
| 1-(2- | furyl)propan-1-ol |
| 1-(a- | furyl)propanol |
