| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 3976-75-8 |
| FDA UNII: | 2I7KCN588V |
| Category: | solvents |
| IUPAC Name: | thiolane diol |
| InChI : | InChI=1/C4H10O2S/c5-7(6)3-1-2-4-7/h5-6H,1-4H2 |
| Std.InChI: | InChI=1S/C4H10O2S/c5-7(6)3-1-2-4-7/h5-6H,1-4H2 |
| InChIKey : | VRHORLVXZKEKHB-UHFFFAOYAB |
| Std.InChIKey: | VRHORLVXZKEKHB-UHFFFAOYSA-N |
| SMILES : | C1CCS(C1)(O)O |
| Molar Refractivity : | 28.17 ± 0.5 cm3 (est) |
| Parachor : | 235.1 ± 8.0 cm3 (est) |
| Index of Refraction : | 1.551 ± 0.05 (est) |
| Surface Tension : | 50.4 ± 7.0 dyne/cm (est) |
| Density : | 1.38 ± 0.1 g/cm3 (est) |
| Polarizability : | 11.17 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Flash Point: | 32.00 °F. TCC ( 0.00 °C. ) (est) |
| Soluble in: | |
| water, 1955 mg/L @ 25 °C (est) | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | solvents |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| solvents | |||
| Recommendation for thiolane diol usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for thiolane diol flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :15869436 |
| National Institute of Allergy and Infectious Diseases:Data |
| (3S,4R)-thiolane-3,4-diol |
| Chemidplus:0003976758 |
| (3S,4R)-thiolane-3,4-diol | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 15869436 |
| Pubchem (sid): | 163639198 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| solvents |
| not found in nature |
| cis-3,4- | dihydroxythiolane |
| (Z)- | tetrahydro-3,4-thiophene diol |
| cis- | tetrahydro-3,4-thiophene diol |
| cis- | tetrahydrothiophene-3,4-diol |
| (3S,4R)- | thiolane-3,4-diol |
| thiolanediol | |
| thiophene, 1,1,2,3,4,5-hexahydro-1,1-dihydroxy- | |
| 3,4- | thiophenediol, tetrahydro-, (3R,4S)-rel- |
| 3,4- | thiophenediol, tetrahydro-, cis- |
