| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 37519-97-4 |
| FDA UNII: | 2U2PG80P22 |
| Category: | flavor and fragrance agents |
| IUPAC Name: | dihydrofarnesol |
| InChI : | InChI=1/C15H28O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,15-16H,5-6,8,10-12H2,1-4H3/b14-9+ |
| Std.InChI: | InChI=1S/C15H28O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,15-16H,5-6,8,10-12H2,1-4H3/b14-9+ |
| InChIKey : | OOOOFOPLSIWRAR-NTEUORMPBL |
| Std.InChIKey: | OOOOFOPLSIWRAR-NTEUORMPSA-N |
| SMILES : | CC(CC/C=C(\C)/CCC=C(C)C)CCO |
| Molar Refractivity : | 72.83 ± 0.3 cm3 (est) |
| Parachor : | 609.8 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.470 ± 0.02 (est) |
| Surface Tension : | 29.8 ± 3.0 dyne/cm (est) |
| Density : | 0.860 ± 0.06 g/cm3 (est) |
| Polarizability : | 28.87 ± 0.5 10-24cm3 (est) |
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 307.00 to 308.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.000065 mmHg @ 25.00 °C. (est) |
| Flash Point: | 224.00 °F. TCC ( 106.70 °C. ) (est) |
| logP (o/w): | 5.876 (est) |
| Soluble in: | |
| alcohol | |
| water, 1.061 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| None found |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :5280341 |
| National Institute of Allergy and Infectious Diseases:Data |
| (6E)-3,7,11-trimethyldodeca-6,10-dien-1-ol |
| Chemidplus:0051411246 |
| Leffingwell: | Chirality or Article |
| (6E)-3,7,11-trimethyldodeca-6,10-dien-1-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 5280341 |
| Pubchem (sid): | 135264067 |
| Pherobase: | View |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | HMDB32218 |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| For Odor |
| No odor group found for these |
| satinaldehyde FL/FR |
| aldehydic |
| aldehydic |
9- decenalFL/FR |
| citrus |
| tangerine nitrile FR |
| floral |
| cyclamen aldehyde FL/FR |
| cyclamen fragrance FR |
| cyclamen propanal FR |
| cyclamen specialty FR |
4- cyclohexyl cyclohexanoneFR |
alpha- damasconeFL/FR |
2- ethyl hexyl salicylateFR |
| floral specialty FR |
| hyacinth acetals FL/FR |
| leerall FR |
| magnolia decadienal FR |
| ocean propanal FL/FR |
| herbal |
2- cyclohexyl cyclohexanoneFR |
| For Flavor |
| No flavor group found for these |
9- decenalFL/FR |
| aromatic |
| aromatic |
| hyacinth acetals FL/FR |
| floral |
| ocean propanal FL/FR |
| satinaldehyde FL/FR |
| fruity |
alpha- damasconeFL/FR |
| green |
| cyclamen aldehyde FL/FR |
3-(5- methyl-2-furyl) butanalFL |
| None Found |
| found in nature |
| 6,10- | dodecadien-1-ol, 3,7,11-trimethyl-, (6E)- |
| 3,7,11- | trimethyl-6,10-dodecadien-1-ol |
| (6E)-3,7,11- | trimethyldodeca-6,10-dien-1-ol |
