| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 3468-63-1 |
| ECHA EC Number: | 222-429-4 |
| FDA UNII: | E27LT0986O |
| Category: | information only not used for fragrances or flavors |
| IUPAC Name: | ci 12075 |
| InChI : | InChI=1/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,17H/b18-16- |
| Std.InChI: | InChI=1S/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,17H/b18-16- |
| InChIKey : | JABZBOSSCDRKEA-VLGSPTGOBG |
| Std.InChIKey: | JABZBOSSCDRKEA-VLGSPTGOSA-N |
| SMILES : | [O-][N+](=O)c1ccc(c([N+]([O-])=O)c1)N/N=C2/c3ccccc3\C=C/C2=O |
| MDL: | MFCD00059524 |
| Molar Refractivity : | 86.91 ± 0.5 cm3 (est) |
| Parachor : | 643.8 ± 8.0 cm3 (est) |
| Index of Refraction : | 1.711 ± 0.05 (est) |
| Surface Tension : | 70.7 ± 7.0 dyne/cm (est) |
| Density : | 1.52 ± 0.1 g/cm3 (est) |
| Polarizability : | 34.45 ± 0.5 10-24cm3 (est) |
| Appearance: | orange powder (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Melting Point: | 302.00 °C. @ 760.00 mm Hg (est) |
| Boiling Point: | 533.75 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 9.320000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 530.00 °F. TCC ( 276.60 °C. ) (est) |
| logP (o/w): | 3.610 (est) |
| Soluble in: | |
| water, 0.1336 mg/L @ 25 °C (est) | |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| Pigment orange 5 95% |
| Chemway Chemical |
| Pigment Orange 5 |
| Kishi Kasei |
| Orange No.203 |
| Rung International |
| Pigment Nitraniline Orange |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Permanent Orange |
| Sigma-Aldrich |
| For experimental / research use only. |
| Pigment Orange 5 analytical standard |
| TCI AMERICA |
| For experimental / research use only. |
| Permanent Orange >90.0%(E) |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| information only not used for fragrances or flavors | |||
| Recommendation for ci 12075 usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for ci 12075 flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| Chemical Carcinogenesis Research Information System:Search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA GENetic TOXicology:Search |
| EPA Substance Registry Services (TSCA):3468-63-1 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :9570132 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:3 |
| (1Z)-1-[(2,4-dinitrophenyl)hydrazinylidene]naphthalen-2-one |
| Chemidplus:0003468631 |
| RTECS:QL3854000 for cas# 3468-63-1 |
| (1Z)-1-[(2,4-dinitrophenyl)hydrazinylidene]naphthalen-2-one | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 3468-63-1 |
| Pubchem (cid): | 9570132 |
| Pubchem (sid): | 134985158 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 3204.17.9086 |
| FDA Color Additive Status List | View |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| brilliant tangerine 13030 | |
| c.i. 12075 | |
| C.I. pigment orange 5 | |
| calcotone orange 2G | |
| carnelio red 2G | |
| D & C orange no. 17 | |
| D and C orange no. 17 | |
| D&C orange 17 | |
| D&C orange no. 17 | |
| dainichi permanent red GG | |
| dc orange no. 17 | |
| dinitraniline orange | |
| dinitroaniline orange | |
| dinitroaniline red | |
| 1-((2,4- | dinitrophenyl)azo)-2-naphthalenol |
| 1-((2,4- | dinitrophenyl)azo)-2-naphthol |
| (1Z)-1-[(2,4- | dinitrophenyl)hydrazinylidene]naphthalen-2-one |
| fastona red 2G | |
| graphtol red 2GL | |
| hansa orange RN | |
| helio fast orange 3RN | |
| helio fast orange RN | |
| irgalite fast red 2GL | |
| irgalite red 2G | |
| irgalite red 2GW | |
| iso | l fast red 2G |
| lake red 2GL | |
| light orange R | |
| lutetia fast orange R | |
| monolite fast orange 2R | |
| monolite fast paper orange 2R | |
| monolite fast red 2G | |
| 2- | naphthalenol, 1-((2,4-dinitrophenyl)azo)- |
| 2- | naphthol, 1-((2,4-dinitrophenyl)azo)- |
| nippon orange X-881 | |
| oralith red 2GL | |
| orange no. 203 | |
| orange no.203 | |
| orange pigment X | |
| permanent orange (VAN) | |
| permanent orange DN toner | |
| permanent orange GG | |
| permanent orange HD | |
| permanent red GG | |
| permansa orange | |
| permatone orange | |
| pigment fast orange | |
| pigment nitraniline orange | |
| pigment orange 5 | |
| segnale light orange RN | |
| siegle orange 2S | |
| silopol orange R | |
| silosol orange RN | |
| syton fast red 2G | |
| tertropigment orange LRN | |
| versal orange RNL |
| None found yet. Try the PubMed Search. |
