| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 33530-46-0 |
| FDA UNII: | Search |
| Category: | flavor and fragrance agents |
| IUPAC Name: | (S,S)-strawberry glycidate 1 |
| InChI : | InChI=1/C12H14O3/c1-3-14-11(13)10-12(2,15-10)9-7-5-4-6-8-9/h4-8,10H,3H2,1-2H3/t10-,12+/m1/s1 |
| Std.InChI: | InChI=1S/C12H14O3/c1-3-14-11(13)10-12(2,15-10)9-7-5-4-6-8-9/h4-8,10H,3H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey : | LQKRYVGRPXFFAV-PWSUYJOCBF |
| Std.InChIKey: | LQKRYVGRPXFFAV-PWSUYJOCSA-N |
| SMILES : | CCOC(=O)[C@@H]1[C@](O1)(C)C2=CC=CC=C2 |
| Molar Refractivity : | 55.46 ± 0.3 cm3 (est) |
| Parachor : | 454.6 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.524 ± 0.02 (est) |
| Surface Tension : | 39.7 ± 3.0 dyne/cm (est) |
| Density : | 1.139 ± 0.06 g/cm3 (est) |
| Polarizability : | 21.98 ± 0.5 10-24cm3 (est) |
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Soluble in: | |
| water, 111.3 mg/L @ 25 °C (est) | |
| None found |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :6993490 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:2 |
| ethyl (2S,3S)-3-methyl-3-phenyloxirane-2-carboxylate |
| ethyl (2S,3S)-3-methyl-3-phenyloxirane-2-carboxylate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 6993490 |
| Pubchem (sid): | 43595842 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| None Found |
| not found in nature |
| (S,S)- | aldehyde C-16 |
| (S,S)- | aldehyde C-16 (EMPG) |
| (S,S)- | aldehyde C-16 (so-called) |
| (S,S)- | aldehyde C16 |
| ethyl (2S,3S)-3-methyl-3-phenyloxirane-2-carboxylate | |
| (S,S)- | ethyl 3-methyl-3-phenyl glycidate |
| (S,S)- | ethyl 3-methyl-3-phenyl-2-oxiranecarboxylate |
| (S,S)- | ethyl methyl phenyl glycidate |
| (S,S)- | fraise pure |
| 2- | oxiranecarboxylic acid, 3-methyl-3-phenyl-, ethyl ester, (2S,3S)-rel- |
| (S,S)- | strawberry aldehyde |
| (S,S)- | strawberry pure |
| None found yet. Try the PubMed Search. |
