| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 324742-96-3 |
| FDA UNII: | 9C20571O7V |
| Category: | flavor and fragrance agents |
| IUPAC Name: | sulfuryl propionate |
| InChI : | InChI=1/C9H13NO2S/c1-3-9(11)12-5-4-8-7(2)10-6-13-8/h6H,3-5H2,1-2H3 |
| Std.InChI: | InChI=1S/C9H13NO2S/c1-3-9(11)12-5-4-8-7(2)10-6-13-8/h6H,3-5H2,1-2H3 |
| InChIKey : | KXYXTLJGFPUWOE-UHFFFAOYAK |
| Std.InChIKey: | KXYXTLJGFPUWOE-UHFFFAOYSA-N |
| SMILES : | Cc1ncsc1CCOC(=O)CC |
| MDL: | MFCD09032912 |
| Molar Refractivity : | 52.77 ± 0.3 cm3 (est) |
| Parachor : | 442.9 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.517 ± 0.02 (est) |
| Surface Tension : | 41.7 ± 3.0 dyne/cm (est) |
| Density : | 1.143 ± 0.06 g/cm3 (est) |
| Polarizability : | 20.92 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 1752 2-(4-methyl-5-thiazolyl)ethyl propionate |
| FEMA Number: | 4276 2-(4-methyl-5-thiazolyl)ethyl propionate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 324742-96-3 ; 2-(4-METHYL-5-THIAZOLYL)ETHYL PROPIONATE |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for sulfuryl propionate usage levels up to: | |||
| 0.0100 % in the fragrance concentrate. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 23 | |||
| Click here to view publication 23 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | 1.00000 | 2.70000 | |
| beverages(nonalcoholic): | - | - | |
| beverages(alcoholic): | - | - | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | - | - | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | - | |
| fruit ices: | 1.00000 | 2.90000 | |
| gelatins / puddings: | - | - | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | - | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :29933357 |
| National Institute of Allergy and Infectious Diseases:Data |
| 2-(4-methyl-1,3-thiazol-5-yl)ethyl propanoate |
| Chemidplus:0324742963 |
| 2-(4-methyl-1,3-thiazol-5-yl)ethyl propanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 324742-96-3 |
| Pubchem (cid): | 29933357 |
| Pubchem (sid): | 125347950 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| HMDB (The Human Metabolome Database): | HMDB32424 |
| FooDB: | FDB009867 |
| ChemSpider: | View |
| For Odor |
| No odor group found for these |
| sulfuryl octanoate FL/FR |
| sulfuryl butyrate FL/FR |
| sulfuryl decanoate FL/FR |
| sulfuryl hexanoate FL/FR |
| sulfuryl isobutyrate FL/FR |
| floral |
| floral |
para- cresyl laurateFL/FR |
| green |
2- heptyl furanFL/FR |
| naphthyl |
ortho- methyl anisoleFL/FR |
| nutty |
2- acetyl-3-methyl pyrazineFL/FR |
3,6- cocoa pyrazineFL/FR |
| filbert heptenone FL/FR |
| nutty quinoxaline FL/FR |
| sulfurous |
| furfuryl thioacetate FL/FR |
| For Flavor |
| No flavor group found for these |
6,7- dihydro-2,3-dimethyl-5H-cyclopentapyrazineFL |
| dimethyl dihydrocyclopentapyrazine FL |
2,5- dimethyl thiazoleFL |
| sulfuryl butyrate FL/FR |
| sulfuryl decanoate FL/FR |
| sulfuryl hexanoate FL/FR |
| sulfuryl isobutyrate FL/FR |
| sulfuryl formate FL |
| sulfuryl octanoate FL/FR |
| camphoreous |
| camphoreous |
ortho- methyl anisoleFL/FR |
| fatty |
2- heptyl furanFL/FR |
| fishy |
4,5- dimethyl thiazoleFL |
| nutty |
2- acetyl-3-methyl pyrazineFL/FR |
3,6- cocoa pyrazineFL/FR |
| filbert heptenone FL/FR |
| nutty quinoxaline FL/FR |
| popcorn |
2- propionyl-2-thiazolineFL |
| roasted |
| furfuryl thioacetate FL/FR |
| waxy |
para- cresyl laurateFL/FR |
| None Found |
| not found in nature |
| 2-(4- | methyl-1,3-thiazol-5-yl)ethyl propanoate |
| 2-(4- | methyl-1,3-thiazol-5-yl)ethyl propionate |
| 4- | methyl-5-thiazoleethanol propionate |
| 2-(4- | methyl-5-thiazolyl) ethyl propionate |
| 2-(4- | methyl-5-thiazolyl)ethyl propionate |
| sulfurol propionate | |
| 5- | thiazoleethanol, 4-methyl-, propanoate (ester) |
| None found yet. Try the PubMed Search. |
