methyl methacrylate/acrylonitrile copolymer
film forming agents
| 2D: |
 |
| 3D: |
|
| CAS Number: |
30396-85-1
|
| FDA UNII: |
Search |
| Category: |
film forming agents |
| IUPAC Name: |
methyl methacrylate/acrylonitrile copolymer |
| InChI : |
InChI=1/C5H8O2.C3H3N/c1-4(2)5(6)7-3;1-2-3-4/h1H2,2-3H3;2H,1H2 |
| Std.InChI: |
InChI=1S/C5H8O2.C3H3N/c1-4(2)5(6)7-3;1-2-3-4/h1H2,2-3H3;2H,1H2 |
| InChIKey : |
SMUVTFSHWISULV-UHFFFAOYAJ |
| Std.InChIKey: |
SMUVTFSHWISULV-UHFFFAOYSA-N |
| SMILES : |
CC(=C)C(=O)OC.C=CC#N |
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
| Not determined |
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
| Category: |
| film forming agents |
| Recommendation for methyl methacrylate/acrylonitrile copolymer usage levels up to: |
| | not for fragrance use. |
| |
| Recommendation for methyl methacrylate/acrylonitrile copolymer flavor usage levels up to: |
| | not for flavor use. |
Safety References:
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):30396-85-1 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :169157 |
| National Institute of Allergy and Infectious Diseases:Data |
| methyl 2-methylprop-2-enoate;prop-2-enenitrile |
| Chemidplus:0030396851 |
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| | methyl 2-methylprop-2-enoate;prop-2-enenitrile |
| 2- | propenoic acid, 2-methyl, methyl ester, polymer with 2-propenenitrile |
