| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 28219-61-6 |
| ECHA EC Number: | 248-908-8 |
| FDA UNII: | V1IKN2SI96 |
| Category: | fragrance agents |
| IUPAC Name: | sandalrome |
| InChI : | InChI=1/C14H24O/c1-5-12(10-15)7-9-13-8-6-11(2)14(13,3)4/h6-7,13,15H,5,8-10H2,1-4H3/b12-7+ |
| Std.InChI: | InChI=1S/C14H24O/c1-5-12(10-15)7-9-13-8-6-11(2)14(13,3)4/h6-7,13,15H,5,8-10H2,1-4H3/b12-7+ |
| InChIKey : | KHQDWCKZXLWDNM-KPKJPENVBY |
| Std.InChIKey: | KHQDWCKZXLWDNM-KPKJPENVSA-N |
| SMILES : | CC/C(=C\CC1CC=C(C1(C)C)C)/CO |
| MDL: | MFCD00067059 |
| Molar Refractivity : | 95.98 ± 0.3 cm3 (est) |
| Parachor : | 540.2 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.478 ± 0.02 (est) |
| Surface Tension : | 28.9 ± 3.0 dyne/cm (est) |
| Density : | 0.894 ± 0.06 g/cm3 (est) |
| Polarizability : | 26.15 ± 0.5 10-24cm3 (est) |
| Fragrance Demo Formulas | |
| Appearance: | colorless to pale yellow clear oily liquid (est) |
| Assay: | 92.00 to 100.00 sum of isomers |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.91300 to 0.91700 @ 25.00 °C. |
| Pounds per Gallon - (est).: | 7.597 to 7.630 |
| Specific Gravity: | 0.91400 to 0.91800 @ 20.00 °C. |
| Pounds per Gallon - est.: | 7.614 to 7.648 |
| Refractive Index: | 1.48600 to 1.49000 @ 20.00 °C. |
| Boiling Point: | 287.37 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.000280 mmHg @ 25.00 °C. (est) |
| Flash Point: | 199.00 °F. TCC ( 92.78 °C. ) |
| logP (o/w): | 4.300 |
| Shelf Life: | 24.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. store under nitrogen. |
| Storage: | store under nitrogen. |
| Soluble in: | |
| alcohol | |
| water, 17 mg/L @ 20 °C (exp) | |
| Stability: | |
| fine fragrances: traces - 10% | |
| antiperspirant | |
| deo stick | |
| detergent: 0.5 - 5% | |
| fabric softener | |
| hard surface cleaner | |
| shampoo: 0.5 - 5% | |
| soap: 0.5 - 5% | |
| APC: traces - 1% | |
| candle: 0.5 - 10% | |
| shower gel: 0.5 - 5% | |
| softener: 0.5 - 5% | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | fragrance perfuming agents |
| ACS International |
| Sandacanol Odor: woody sandalwood greasy oily waxy |
| Operational Capabilities |
| Associate Allied Chemicals |
| Bacdanol |
| About |
| Associate Allied Chemicals |
| Sandranol |
| Associate Allied Chemicals |
| Sanjinol Toco |
| Augustus Oils |
| Bacdanol |
| Services |
| Azelis UK |
| BACDANOL |
| Azelis UK |
| DARTANOL™ |
| Azelis UK |
| SANJINOL |
| Beijing Lys Chemicals |
| Bacdanol |
| Berjé |
| Sandacanol (Bacdanal® Type) |
| Media |
| BOC Sciences |
| For experimental / research use only. |
| Sandacanol |
| Creatingperfume.com |
| Bacdanol (IFF) Odor: Typical sandal note, warm and woody like Sandalwood oil |
| Creatingperfume.com |
| DARTANOL™ ( Firmenich ) Odor: sandalwood, slightly cedarwood, creamy |
| Diffusions Aromatiques |
| BACDENOL |
| DRT Terpenes |
| SANDEROL GH Purity (sum of 2 isomers) (%) : ≥ 95 |
| DRT Terpenes |
| SANDEROL RH Purity (sum of 2 isomers) (%) : ≥ 95 |
| Ernesto Ventós |
| BACDANOL IFF |
| Ernesto Ventós |
| LEVOSANDOL Odor: SANDALWOOD, BALSAMIC, WOODY |
| Ernesto Ventós |
| SANDOL Odor: NOTES OF SANDALWOOD AND ROSE |
| Ernesto Ventós |
| SANJINOL IFF Odor: SANDALWOOD, FLORAL, WOODY |
| Fine Fragrances Pvt Ltd |
| Bacdanol |
| Fine Fragrances Pvt Ltd |
| Sanjinol |
| Firmenich |
| DARTANOL® for fragrance Odor: Sandalwood, slightly cedarwood, creamy. Softer and more cosmetic than POLYSANTOL®, but less strong Use: A sandalwood molecule with a creamy natural milky aspect which gives it a cosmetic character.Can be used at higher level than POLYSANTOL®. Gives a creamerand more cosmetic connotation than the preceding ones. Excellent incombination with POLYSANTOL®. It gives the body to the sandalwoodconnotation as the others give the character and the strength on the top. |
| Gem Aromatics |
| Bacdanol |
| IFF |
| Bacdanol® Odor: Powerful, true sandalwood note. Provides excellent long lasting floral support. Extremely diffusive and very cost effective. Non-discolouring |
| IFF |
| Sanjinol Odor: Natural sandalwood-like odor. Good diffusion and substantivity |
| Indukern F&F |
| SANDOL - BACDANOL Odor: SANDALWOOD, ROSE |
| Indukern F&F |
| SANJINOL Odor: SANDALWOOD, FLORAL, WOODY |
| K.L. Koh Enterprise |
| SANDACANOL |
| Keva |
| BARANOL |
| Kun Shan P&A |
| Sandalwood 208 / Bacdanol |
| Kun Shan P&A |
| Sanjinol |
| Lluch Essence |
| BANGALOL |
| M&U International |
| Bacdanol |
| M&U International |
| Sandenol 208 (bacdanol) |
| M&U International |
| Sanjinol(IFF# : 190716) |
| Moellhausen |
| SANDALROME Odor: powerful sandalwood note |
| OQEMA |
| Landacanol |
| Organica Aromatics |
| SANDANOL NLT 90%(sum of isomers) |
| PCW France |
| Bagdenol |
| Steps to a fragranced product |
| Pearlchem Corporation |
| Bacdanol - Pearl 208 |
| Pell Wall Perfumes |
| Dartanol Odor: Sandalwood, creamy, floral-rose, cedarwood Use: The same molecule as the IFF sandalwood odourant Bacdanol, but this is the laevo isomer. According to Arcadi Boix Camps Dartanol “is similar but more beautiful, more radiant, posessing a more natural sandalwood character. It is also more diffusive”. We sometimes also have stock of the IFF equivalent called Sanjinol, which is also the laevo isomer. |
| Pell Wall Perfumes |
| Sanjinol |
| Penta International |
| BACDANOL |
| PerfumersWorld |
| Bacdanol Odor: Woody sandalwood sweet balsamic Use: BLENDS WITH - +Cedarwood To Sweeten +Cubeb +Guaiacwood +Labdanum +Gurjun Balsam +Sandalwood |
| Perfumery Laboratory |
| DARTHANOL ™ Firmenich (DARTANOL ™ Firmenich) Odor: Sweet, waxy, rich aroma of sandalwood with creamy cedar note |
| Phoenix Aromas & Essential Oils |
| Bacdanix |
| Prasad Organics |
| Pracdonal |
| Prinova |
| Finanol |
| Privi Organics |
| Sandal Fleur Laevo |
| Sunaux International |
| Sandenol 208 |
| Symrise |
| Sandranol® Odor: typical sandal note, warm and woody, similar to sandalwood oil, gives the impression of freshly cut sandalwood Use: Stable in: body lotion (good), shampoo (good), soap (good), ap roll-on (poor), powder (good), cleaner citric (poor), cleaner apc (good), bleach (poor). |
| Taytonn ASCC |
| Bacdanol® |
| Taytonn ASCC |
| Sanjinol Odor: Floral, Sandalwood, Woody |
| The John D. Walsh Company |
| Bacdanol |
| The John D. Walsh Company |
| Sanjinol |
| The Lermond Company |
| SANDACANOL |
| Vigon International |
| Dartanol |
| Vigon International |
| Sanderol RH (Bacdanol) Odor: Typical sandal note, warm and woody like Sandalwood oil, gives the impression of freshly cut Sandalwood |
| Vistachem |
| Sandacanol |
| WholeChem |
| Bacdanol |
| Zanos |
| Sanderol RH Odor: Sandalwood round woody |
| European information : | |
| Most important hazard(s): | |
| Xi N - Irritant, Dangerous for the environment. | |
| R 38 - Irritating to skin. R 50/53 - Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| Skin irritation (Category 2), H315 Eye irritation (Category 2A), H319 Serious eye damage/eye irritation (Category 2A), H320 Acute aquatic toxicity (Category 1), H400 Chronic aquatic toxicity (Category 1), H410 | |
| GHS Label elements, including precautionary statements | |
| Pictogram |   |
| Signal word | Warning |
| Hazard statement(s) | |
| H315 - Causes skin irritation H319 - Causes serious eye irritation H320 - Causes eye irritation H400 - Very toxic to aquatic life H410 - Very toxic to aquatic life with long lasting effects | |
| Precautionary statement(s) | |
| P264 - Wash skin thouroughly after handling. P273 - Avoid release to the environment. P280 - Wear protective gloves/protective clothing/eye protection/face protection. P302 + P352 - IF ON SKIN: wash with plenty of soap and water. P305 + P351 + P338 - IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. P332 + P313 - IF SKIN irritation occurs: Get medical advice/attention. P337 + P313 - IF eye irritation persists: Get medical advice/attention. P362 - Take off contaminated clothing and wash before reuse. P391 - Collect spillage. Hazardous to the aquatic environment P501 - Dispose of contents/container in accordance with local/regional/national/international regulations. | |
| Oral/Parenteral Toxicity: | |
| oral-rat LD50 5000 mg/kg Dispose of contents/container in accordance with local/regional/national/international regulations. | |
| Dermal Toxicity: | |
| skin-rabbit LD50 > 2000 mg/kg Dispose of contents/container in accordance with local/regional/national/international regulations. | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for sandalrome usage levels up to: | |||
| 10.0000 % in the fragrance concentrate. | |||
| Recommendation for sandalrome flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):28219-61-6 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :6438196 |
| National Institute of Allergy and Infectious Diseases:Data |
| WISER:UN 3082 |
| WGK Germany:2 |
| (E)-2-ethyl-4-(2,2,3-trimethyl-1-cyclopent-3-enyl)but-2-en-1-ol |
| Chemidplus:0028219616 |
| (Z)-2-ethyl-4-(2,2,3-trimethyl-1-cyclopent-3-enyl)but-2-en-1-ol |
| (E)-2-ethyl-4-(2,2,3-trimethyl-1-cyclopent-3-enyl)but-2-en-1-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 28219-61-6 |
| Pubchem (cid): | 6438196 |
| Pubchem (sid): | 135077158 |
| (Z)-2-ethyl-4-(2,2,3-trimethyl-1-cyclopent-3-enyl)but-2-en-1-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 28219-61-6 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 2906.19.5000 |
| ChemSpider: | View |
| not found in nature |
| bacdanix | |
| bacdanol (IFF) | |
| bagdenol | |
| balinol | |
| bangalo | |
| bangalol (Quest) | |
| 2- | buten-1-ol 2-ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl) |
| 2- | buten-1-ol, 2-ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)- |
| dartanol (Firmenich) | |
| ethyl trimethyl cyclopentene butenol | |
| (E)-2- | ethyl-4-(2,2,3-trimethyl-1-cyclopent-3-enyl)but-2-en-1-ol |
| 2- | ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol |
| 2- | ethyl-4-(2,2,3-trimethylcyclopent-3-en-yl)-but-2-en-1-ol |
| finanol | |
| landacanol | |
| levo sandol | |
| levosandol (Takasago) | |
| pracdonal | |
| radjanol | |
| sandacanol (A.C.S. International) | |
| sandal fleur | |
| sandalrome | |
| sandenol 208 | |
| sanderol | |
| sanderol GH | |
| sanderol RH | |
| sandolene | |
| sandranol (Symrise) | |
| sanjinol (IFF) |
| None found yet. Try the PubMed Search. |
