| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 27458-93-1 |
| ECHA EC Number: | 248-470-8 |
| FDA UNII: | Q613OCQ44Y |
| Category: | emollients |
| IUPAC Name: | isostearyl alcohol |
| InChI : | InChI=1/C18H38O/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h18-19H,3-17H2,1-2H3 |
| Std.InChI: | InChI=1S/C18H38O/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h18-19H,3-17H2,1-2H3 |
| InChIKey : | WNWHHMBRJJOGFJ-UHFFFAOYAM |
| Std.InChIKey: | WNWHHMBRJJOGFJ-UHFFFAOYSA-N |
| SMILES : | CC(C)CCCCCCCCCCCCCCCO |
| Molar Refractivity : | 86.93 ± 0.3 cm3 (est) |
| Parachor : | 762.3 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.449 ± 0.02 (est) |
| Surface Tension : | 30.8 ± 3.0 dyne/cm (est) |
| Density : | 0.836 ± 0.06 g/cm3 (est) |
| Polarizability : | 34.46 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 331.00 to 332.00 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 257.00 °F. TCC ( 124.90 °C. ) (est) |
| logP (o/w): | 7.815 (est) |
| Soluble in: | |
| water, 0.01745 mg/L @ 25 °C (est) | |
| Allan Chemical |
| isoStearyl Alcohol |
| Alzo International |
| Dermocol I-18T |
| BOC Sciences |
| For experimental / research use only. |
| Isooctadecanol 95% |
| Gattefosse |
| Emulfree® CBG Odor: characteristic Use: �Surfactant free system, Water resistant, Ultra-light sensation. |
| Jarchem Industries |
| Jarcol™ I-18CG Odor: characteristic Use: A versatile liquid alcohol suitable for all cosmetic applications. |
| Jarchem Industries |
| Jarcol™ I-18EX Odor: characteristic Use: A versatile liquid alcohol suitable for industrial applications and further reaction. |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| emollients | |||
| Recommendation for isostearyl alcohol usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for isostearyl alcohol flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):27458-93-1 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :62825 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:1 |
| 16-methylheptadecan-1-ol |
| Chemidplus:0027458931 |
| 16-methylheptadecan-1-ol | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 27458-93-1 |
| Pubchem (cid): | 62825 |
| Pubchem (sid): | 135020888 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| CHEMBL: | View |
| KEGG (GenomeNet): | D04633 |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| emollients | |
| viscosity controlling agents |
| not found in nature |
| adol 66 | |
| dermocol I-18T | |
| emulfree CBG | |
| 1- | heptadecanol, 16-methyl- |
| jarcol I-18CG | |
| jarcol I-18EX | |
| 16- | methyl-1-heptadecanol |
| 16- | methylheptadecan-1-ol |
| iso | octadecan-1-ol |
| iso | octadecanol |
| iso | octadecyl alcohol |
