| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 2206-94-2 |
| ECHA EC Number: | 218-620-7 |
| FDA UNII: | 1CC5K86844 |
| Category: | fragrance agents |
| IUPAC Name: | indocolore (Firmenich) |
| InChI : | InChI=1/C10H10O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-7H,1H2,2H3 |
| Std.InChI: | InChI=1S/C10H10O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-7H,1H2,2H3 |
| InChIKey : | HWCUCNKPBMGSSC-UHFFFAOYAX |
| Std.InChIKey: | HWCUCNKPBMGSSC-UHFFFAOYSA-N |
| SMILES : | O=C(O\C(=C)c1ccccc1)C |
| Molar Refractivity : | 46.85 ± 0.3 cm3 (est) |
| Parachor : | 376.8 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.515 ± 0.02 (est) |
| Surface Tension : | 34.7 ± 3.0 dyne/cm (est) |
| Density : | 1.044 ± 0.06 g/cm3 (est) |
| Polarizability : | 18.57 ± 0.5 10-24cm3 (est) |
| Fragrance Demo Formulas | |
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 247.57 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.025000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 183.00 °F. TCC ( 84.00 °C. ) (est) |
| logP (o/w): | 2.130 |
| Soluble in: | |
| alcohol | |
| water, 498.1 mg/L @ 25 °C (est) | |
| Stability: | |
| APC: traces - 0.5% | |
| candle: traces - 0.5% | |
| detergent: traces - 0.5% | |
| fine fragrances: traces - 0.5% | |
| shampoo: traces - 0.5% | |
| shower gel: traces - 0.5% | |
| soap: traces - 0.5% | |
| softener: traces - 0.5% | |
| None found |
| Azelis UK |
| INDOCOLORE™ |
| Ernesto Ventós |
| INDOCOLORE FIRMENICH 949021 Odor: ANIMALIC, FLORAL, HYACINTH |
| Firmenich |
| INDOCOLORE® for fragrance Odor: INDOCOLORE is more floral than Indol, but less naphtalenic than Indol Use: This non-coloring Indol note is a technical solution to create clear and powerful florals. |
| Perfumery Laboratory |
| INDOCOLOR ™ 1% in Firmenich JV (INDOCOLORE ™ 1% Firmenich) Odor: Diffuse, indole, warm, animalistic, floral, with characteristic notes of jasmine and hyacinth |
| Vigon International |
| Indocolore |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for indocolore (Firmenich) flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):2206-94-2 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :75153 |
| National Institute of Allergy and Infectious Diseases:Data |
| 1-phenylethenyl acetate |
| Chemidplus:0002206942 |
| 1-phenylethenyl acetate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 75153 |
| Pubchem (sid): | 135032764 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| For Odor |
| animal |
para- cresyl isobutyrateFL/FR |
| ethyl 4-methyl salicylate FL/FR |
| indolall FR |
| indole FL/FR |
| floral |
| honeysuckle fragrance FR |
| honeysuckle specialty FR |
| narcissus fragrance FR |
| narcissus specialty FR |
| nyctanthes arbor-tristis flower absolute FR |
| styralyl valerate FR |
| musk |
| musk nonane FR |
| powdery |
| powdery animal fragrance FR |
| For Flavor |
| No flavor group found for these |
| ethyl 4-methyl salicylate FL/FR |
| animal |
| animal |
| indole FL/FR |
| aromatic |
para- cresyl isobutyrateFL/FR |
| None Found |
| not found in nature |
| a- | acetoxystyrene |
| alpha- | acetoxystyrene |
| benzenemethanol, a-methylene-, acetate | |
| benzyl alcohol, a-methylene-, acetate | |
| ethenol, 1-phenyl-, acetate | |
| alpha- | methylene benzyl acetate |
| a- | methylenebenzyl acetate |
| 1- | phenyl ethenyl acetate |
| 1- | phenyl vinyl acetate |
| 1- | phenylethenyl acetate |
| 1- | phenylvinyl acetate |
| None found yet. Try the PubMed Search. |
