| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 203719-53-3 |
| FDA UNII: | 19GI74JS93 |
| Category: | flavor and fragrance agents |
| IUPAC Name: | laevo-limonene oxide |
| InChI : | InChI=1/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m0/s1 |
| Std.InChI: | InChI=1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m0/s1 |
| InChIKey : | CCEFMUBVSUDRLG-IDKOKCKLBE |
| Std.InChIKey: | CCEFMUBVSUDRLG-IDKOKCKLSA-N |
| SMILES : | CC(=C)[C@H]1CCC2(C(C1)O2)C |
| MDL: | MFCD00074770 |
| Molar Refractivity : | 45.31 ± 0.3 cm3 (est) |
| Parachor : | 369.4 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.490 ± 0.02 (est) |
| Surface Tension : | 31.0 ± 3.0 dyne/cm (est) |
| Density : | 0.972 ± 0.06 g/cm3 (est) |
| Polarizability : | 17.96 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 2146 L-8-p-menthene-1,2-epoxide |
| FEMA Number: | 4656 L-8-p-menthene-1,2-epoxide |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 203719-53-3 ; L-8-P-MENTHENE-1,2-EPOXIDE |
| Appearance: | colorless clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.92600 to 0.93600 @ 20.00 °C. |
| Pounds per Gallon - (est).: | 7.714 to 7.798 |
| Refractive Index: | 1.46400 to 1.47400 @ 20.00 °C. |
| Boiling Point: | 197.00 to 199.00 °C. @ 760.00 mm Hg |
| Vapor Pressure: | 0.515000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 150.00 °F. TCC ( 65.56 °C. ) |
| logP (o/w): | 3.200 (est) |
| Shelf Life: | 12.00 month(s) or longer if stored properly. |
| Storage: | refrigerate in tightly sealed containers. |
| Soluble in: | |
| alcohol | |
| water, 137.2 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| None found |
| Axsyn |
| For experimental / research use only. |
| laevo-7-Oxabicyclo[4.1.0]heptane, 1-methyl-4-(1-methylethenyl)-, (4S)- |
| Nippon Terpene Chemicals |
| l-Limonene oxide 95% up (cis+trans) |
| Sigma-Aldrich: Aldrich |
| For experimental / research use only. |
| (-)-Limonene oxide, mixture of cis and trans 99% |
| Chemical Sources Association |
| Need This Item for Flavor/Food?: You can contact the Chemical Sources Association |
| Preferred SDS: View | |
| European information : | |
| Most important hazard(s): | |
| None - None found. | |
| S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 24 | |||
| Click here to view publication 24 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | - | |
| beverages(nonalcoholic): | 0.10000 | 0.50000 | |
| beverages(alcoholic): | 0.20000 | 1.00000 | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | 1.00000 | 5.00000 | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | - | |
| fruit ices: | - | - | |
| gelatins / puddings: | 0.20000 | 1.00000 | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | 0.50000 | 2.50000 | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :10953718 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:3 |
| (4S)-1-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane |
| Chemidplus:0203719533 |
| (4S)-1-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 10953718 |
| Pubchem (sid): | 42083799 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| CHEBI: | View |
| KEGG (GenomeNet): | C19081 |
| HMDB (The Human Metabolome Database): | Search |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| None Found |
| None Found |
| 7-oxa | bicyclo[4.1.0]heptane, 1-methyl-4-(1-methylethenyl)-, (4S)- |
| laevo-7-oxa | bicyclo[4.1.0]heptane, 1-methyl-4-(1-methylethenyl)-, (4S)- |
| L-1,2- | epoxy-p-menth-8-ene |
| laevo-1,2- | epoxy-para-menth-8-ene |
| L-1,2- | epoxylimonene |
| laevo-1,2- | epoxylimonene |
| L- | limonene 1,2-epoxide |
| laevo- | limonene 1,2-epoxide |
| L- | limonene epoxide |
| laevo- | limonene epoxide |
| L- | limonene oxide |
| (-)- | limonene oxide, mixture of cis and trans |
| (4S)- | limonene-1,2-epoxide |
| L-8-p- | menthene-1,2-epoxide |
| laevo-8-para- | menthene-1,2-epoxide |
| (4S)-1- | methyl-3-(prop-1-en-2-yl)-7-oxabicyclo(4.1.0)heptane |
| (4S)-1- | methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane |
| (4S)-1- | methyl-4-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane |
| (4S)-1- | methyl-4-(1-methylvinyl)-7-oxabicyclo[4.1.0]heptane |
| (4S)-1- | methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane |
| (4S)-1- | methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane |
| (4S)-4-iso | propenyl-1-methyl-7-oxabicyclo[4.1.0]heptane |
| None found yet. Try the PubMed Search. |
