2-octyl laurate
emollients
| 2D: |
 |
| 3D: |
|
| CAS Number: |
20292-08-4
|
| ECHA EC Number: |
243-697-9 |
| FDA UNII: |
8J6M396U72 |
| Category: |
emollients |
| IUPAC Name: |
2-octyl laurate |
| InChI : |
InChI=1/C20H40O2/c1-4-7-9-10-11-12-13-14-15-17-20(21)22-18-19(6-3)16-8-5-2/h19H,4-18H2,1-3H3 |
| Std.InChI: |
InChI=1S/C20H40O2/c1-4-7-9-10-11-12-13-14-15-17-20(21)22-18-19(6-3)16-8-5-2/h19H,4-18H2,1-3H3 |
| InChIKey : |
LWLRMRFJCCMNML-UHFFFAOYAH |
| Std.InChIKey: |
LWLRMRFJCCMNML-UHFFFAOYSA-N |
| SMILES : |
CCCCCCCCCCCC(=O)OCC(CC)CCCC |
| Molar Refractivity : |
96.43 ± 0.3 cm3 (est) |
| Parachor : |
849.9 ± 4.0 cm3 (est) |
| Index of Refraction : |
1.444 ± 0.02 (est) |
| Surface Tension : |
30.2 ± 3.0 dyne/cm (est) |
| Density : |
0.862 ± 0.06 g/cm3 (est) |
| Polarizability : |
38.23 ± 0.5 10-24cm3 (est) |
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 353.00 to 356.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.000033 mmHg @ 25.00 °C. (est) |
| Flash Point: | 340.00 °F. TCC ( 170.90 °C. ) (est) |
| logP (o/w): | 8.030 |
| Soluble in: |
| | alcohol |
| | water, 0.001439 mg/L @ 25 °C (est) |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
| Not determined |
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
| Category: |
| emollients |
| Recommendation for 2-octyl laurate usage levels up to: |
| | not for fragrance use. |
| |
| Recommendation for 2-octyl laurate flavor usage levels up to: |
| | not for flavor use. |
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| | dodecanoic acid 2-ethyl hexyl ester |
| | dodecanoic acid 2-ethylhexyl ester |
| | dodecanoic acid, 2-ethylhexyl ester |
| 2- | ethyl hexyl dodecanoate |
| 2- | ethyl hexyl laurate |
| 2- | ethylhexyl dodecanoate |
| 2- | ethylhexyl laurate |
| | lubricit 2-EHL |
| 2- | octyl dodecanoate |
| 2- | octyl laurate |
