| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 15399-05-0 |
| FDA UNII: | R64374A2E5 |
| Category: | flavor and fragrance agents |
| IUPAC Name: | ethyl phenyl lactate |
| InChI : | InChI=1/C11H14O3/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3 |
| Std.InChI: | InChI=1S/C11H14O3/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3 |
| InChIKey : | HBOGUIFRIAXYNB-UHFFFAOYAM |
| Std.InChIKey: | HBOGUIFRIAXYNB-UHFFFAOYSA-N |
| SMILES : | CCOC(=O)C(CC1=CC=CC=C1)O |
| Molar Refractivity : | 52.96 ± 0.3 cm3 (est) |
| Parachor : | 442.0 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.523 ± 0.02 (est) |
| Surface Tension : | 42.5 ± 3.0 dyne/cm (est) |
| Density : | 1.121 ± 0.06 g/cm3 (est) |
| Polarizability : | 20.99 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 2213 ethyl 2-hydroxy-3-phenylpropionate |
| FEMA Number: | 4598 ethyl 2-hydroxy-3-phenylpropionate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 15399-05-0 ; ETHYL 2-HYDROXY-3-PHENYLPROPIONATE |
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 1.09200 to 1.10200 @ 25.00 °C. |
| Pounds per Gallon - (est).: | 9.087 to 9.170 |
| Refractive Index: | 1.52800 to 1.53800 @ 20.00 °C. |
| Boiling Point: | 298.00 to 300.00 °C. @ 760.00 mm Hg |
| Acid Value: | 1.00 max. KOH/g |
| Vapor Pressure: | 0.000460 mmHg @ 25.00 °C. (est) |
| Flash Point: | 256.00 °F. TCC ( 124.44 °C. ) |
| logP (o/w): | 1.774 (est) |
| Soluble in: | |
| alcohol | |
| water, 7553 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| Similar Items:note | |
| amyl lactate | |
| isoamyl lactate | |
| benzyl lactate | |
| butyl butyryl lactate | |
| butyl lactate | |
| isobutyl lactate | |
| sec-butyl lactate | |
| butyl laevo-lactate | |
| cetyl lactate | |
| dodecyl lactate | |
| ethyl acetyl lactate | |
| ethyl butyryl lactate | |
| ethyl lactate | |
| (Z)-3-hexen-1-yl lactate | |
| hexyl lactate | |
| laevo-menthyl lactate | |
| menthyl methyl lactate | |
| methyl dextro-lactate | |
| methyl laevo-lactate | |
| phenethyl lactate | |
| propyl lactate | |
| vanillyl lactate | |
| None found |
| Axsyn |
| For experimental / research use only. |
| Benzenepropanoic acid, a-hydroxy-, ethyl ester |
| Parchem |
| ethyl phenyl lactate |
| Chemical Sources Association |
| Need This Item for Flavor/Food?: You can contact the Chemical Sources Association |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor and fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 24 | |||
| Click here to view publication 24 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | - | |
| beverages(nonalcoholic): | - | - | |
| beverages(alcoholic): | - | - | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | - | - | |
| condiments / relishes: | 0.70000 | 2.00000 | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | - | |
| fruit ices: | - | - | |
| gelatins / puddings: | 0.01000 | 0.10000 | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | - | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :6429708 |
| National Institute of Allergy and Infectious Diseases:Data |
| ethyl 2-hydroxy-3-phenylpropanoate |
| Chemidplus:0015399050 |
| ethyl 2-hydroxy-3-phenylpropanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 6429708 |
| Pubchem (sid): | 10545973 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| CHEBI: | View |
| HMDB (The Human Metabolome Database): | Search |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| For Odor |
| amber |
| angelica seed oil CO2 extract FL/FR |
| balsamic |
| copaiba balsam oil FL/FR |
| copaiba balsam oil replacer FR |
| earthy |
| cabralea cangerana root bark oil FR |
| green |
2,5- dimethyl bicyclo(3.2.1)oct-2-eneFR |
| peppery |
| asarum europaeum oil FR |
| spicy |
| agarospirol FR |
| atractylis root oil FR |
| pepper hexanone FR |
(E,E)- piperineFL/FR |
| terpenic |
| frankincense oil FL/FR |
| woody |
| caryophyllene formate FL/FR |
| frankincense fragrance FR |
| frankincense oil replacer FR |
| olibanum specialty FR |
| xanthoxylum alatum roxb. oil FR |
| For Flavor |
| No flavor group found for these |
| caryophyllene formate FL/FR |
| balsamic |
| balsamic |
| copaiba balsam oil FL/FR |
| herbal |
| angelica seed oil CO2 extract FL/FR |
| spicy |
| cubeb oleoresin FL |
(E,E)- piperineFL/FR |
| woody |
| frankincense oil FL/FR |
| None Found |
| benzenepropanoic acid, a-hydroxy-, ethyl ester | |
| ethyl 2-hydroxy-3-phenyl propanoate | |
| ethyl 2-hydroxy-3-phenyl propionate | |
| ethyl 2-hydroxy-3-phenylpropanoate | |
| ethyl 2-hydroxy-3-phenylpropionate | |
| lactic acid, 3-phenyl-, ethyl ester | |
| propanoic acid, 2-hydroxy-3-phenyl, ethyl ester |
| None found yet. Try the PubMed Search. |
