| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 14992-62-2 |
| FDA UNII: | 07OP6H4V4A |
| Category: | cosmetic ingredient for skin conditioning |
| IUPAC Name: | acetyl carnitine |
| InChI : | InChI=1/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3 |
| Std.InChI: | InChI=1S/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3 |
| InChIKey : | RDHQFKQIGNGIED-UHFFFAOYAB |
| Std.InChIKey: | RDHQFKQIGNGIED-UHFFFAOYSA-N |
| SMILES : | CC(=O)OC(CC([O-])=O)C[N+](C)(C)C |
| MDL: | MFCD00871161 |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Flash Point: | 32.00 °F. TCC ( 0.00 °C. ) (est) |
| logP (o/w): | -4.149 (est) |
| Soluble in: | |
| water, 1e+006 mg/L @ 25 °C (est) | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | skin conditioning |
| BOC Sciences |
| For experimental / research use only. |
| Acetyl-L-carnitine |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| intravenous-mouse LD50 1228 mg/kg Yaoxue Xuebao. Acta Pharmaceutica Sinica. Pharmaceutical Journal. Vol. 20, Pg. 606, 1985. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| cosmetic ingredient for skin conditioning | |||
| Recommendation for acetyl carnitine usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for acetyl carnitine flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :1 |
| National Institute of Allergy and Infectious Diseases:Data |
| 3-acetyloxy-4-(trimethylazaniumyl)butanoate |
| Chemidplus:0014992622 |
| 3-acetyloxy-4-(trimethylazaniumyl)butanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 1 |
| Pubchem (sid): | 135076136 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| Metabolomics Database: | Search |
| HMDB (The Human Metabolome Database): | HMDB00201 |
| VCF-Online: | VCF Volatile Compounds in Food |
| ChemSpider: | View |
| Wikipedia: | View |
| Formulations/Preparations: juvenon: acetyl-l-carnitine and alpha lipoic acid | |
| None Found |
| None Found |
| found in nature |
| 3- | acetoxy-4-(trimethylammonio)butanoate |
| 2-( | acetyl oxy)-3-carboxy-N,N,N-trimethyl-1-propanaminium inner salt |
| acetyl-DL-carnitine | |
| acetylcarnitine | |
| DL-O- | acetylcarnitine |
| 3- | acetyloxy-4-(trimethylazaniumyl)butanoate |
| 3-( | acetyloxy)-4-(trimethylammonio)butanoate |
| ammonium, (3-carboxy-2-hydroxypropyl)trimethyl-, hydroxide, inner salt, acetate, DL- | |
| carnitine, acetyl- | |
| DL- | carnitine, acetyl- |
| 1- | propanaminium, 2-(acetoxy)-3-carboxy-N,N,N-trimethyl-, hydroxide, inner salt, (±)- (9CI) |
| 1- | propanaminium, 2-(acetyloxy)-3-carboxy-N,N,N-trimethyl-, inner salt |
| 1- | propanaminium, 2-(acetyloxy)-3-carboxy-N,N,N-trimethyl-, inner salt; O-acetyl-DL-carnitine |
| None found yet. Try the PubMed Search. |
