| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 141-94-6 |
| ECHA EC Number: | 205-513-5 |
| FDA UNII: | 852A84Y8LS |
| Category: | cosmetic agents |
| IUPAC Name: | hexetidine (mixture of stereoisomers) |
| InChI : | InChI=1/C21H45N3/c1-6-10-12-19(8-3)14-23-16-21(5,22)17-24(18-23)15-20(9-4)13-11-7-2/h19-20H,6-18,22H2,1-5H3 |
| Std.InChI: | InChI=1S/C21H45N3/c1-6-10-12-19(8-3)14-23-16-21(5,22)17-24(18-23)15-20(9-4)13-11-7-2/h19-20H,6-18,22H2,1-5H3 |
| InChIKey : | DTOUUUZOYKYHEP-UHFFFAOYAK |
| Std.InChIKey: | DTOUUUZOYKYHEP-UHFFFAOYSA-N |
| SMILES : | CCCCC(CC)CN1CC(CN(C1)CC(CC)CCCC)(C)N |
| MDL: | MFCD00010428 |
| Molar Refractivity : | 107.91 ± 0.3 cm3 (est) |
| Parachor : | 916.3 ± 6.0 cm3 (est) |
| Index of Refraction : | 1.467 ± 0.02 (est) |
| Surface Tension : | 30.9 ± 3.0 dyne/cm (est) |
| Density : | 0.874 ± 0.06 g/cm3 (est) |
| Polarizability : | 42.77 ± 0.5 10-24cm3 (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.88900 @ 25.00 °C. |
| Boiling Point: | 388.23 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 158.00 °F. TCC ( 70.00 °C. ) |
| logP (o/w): | 7.150 (est) |
| Soluble in: | |
| water, 2.344 mg/L @ 25 °C (est) | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | preservatives solvents |
| BOC Sciences |
| For experimental / research use only. |
| Hexetidine 95% Odor: characteristic Use: Hexetidine, mixture of stereoisomers, is an antibacterial and antifungal agent that destroy fungi by suppressing their ability to grow or reproduce. |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Hexetidine, mixture of stereoisomers 97% |
| Sigma-Aldrich: Aldrich |
| For experimental / research use only. |
| Hexetidine, mixture of stereoisomers |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| cosmetic agents | |||
| Recommendation for hexetidine (mixture of stereoisomers) usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for hexetidine (mixture of stereoisomers) flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| ClinicalTrials.gov:search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):141-94-6 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :3607 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:3 |
| 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine |
| Chemidplus:0000141946 |
| 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 3607 |
| Pubchem (sid): | 134975583 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEMBL: | View |
| KEGG (GenomeNet): | D07068 |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 2933.59.9000 |
| ChemSpider: | View |
| Wikipedia: | View |
| Formulations/Preparations: •glypesin•hexigel•hexocil•hexoral•hextril•oraldene•sterisil•sterisol•oraldene contains 0.1% wv hexetidine (mcneil products limited). | |
| None Found |
| antifoaming agents | |
| solvents |
| not found in nature |
| 5- | amino-1,3-bis(2-ethylhexyl)-5-methyl-hexhydropyrimidine |
| 5- | amino-1,3-bis(2-ethylhexyl)-5-methylhexahydropyrimidine |
| 5- | amino-1,3-bis(2-ethylhexyl)hexahydro-5-methylpyrimidine |
| 5- | amino-1,3-di(b-ethylhexyl)hexahydro-5-methylpyrimidine |
| drossadin | |
| 1,3-bis(2- | ethylhexyl)-5-methyl-1,3-diazaperhydroine-5-ylamine |
| 1,3-bis(2- | ethylhexyl)-5-methyl-1,3-diazinan-5-amine |
| 1,3-bis(b- | ethylhexyl)-5-methyl-5-aminohexahydropyrimidine |
| 1,3-bis(2- | ethylhexyl)-5-methylhexahydro-5-pyrimidinamine |
| 1,3-bis(2- | ethylhexyl)-5-methylhexahydropyrimidin-5-amine |
| 1,3-bis(2- | ethylhexyl)hexahydro-5-methyl-5-pyrimidiamine |
| 1,3-bis(2- | ethylhexyl)hexahydro-5-methyl-5-pyrimidinamine |
| glypesin | |
| hexetidine | |
| hexigel | |
| hexocil | |
| hexopyrimidine | |
| hexoral | |
| paradenyl | |
| 5- | pyrimidinamine, 1,3-bis(2-ethylhexyl)hexahydro-5-methyl- |
| pyrimidine, 5-amino-1, 3-bis (2-ethylhexyl)hexahydro-5-methyl- | |
| pyrimidine, 5-amino-1,3-bis(2-ethylhexyl)hexahydro-5-methyl- (8CI) | |
| sterilate | |
| sterisil | |
| triocil | |
| triscol |
| None found yet. Try the PubMed Search. |
