dimethyl methyl glutarate
solvents
| 2D: |
 |
| 3D: |
|
| CAS Number: |
14035-94-0
|
| FDA UNII: |
728OFW5M9G |
| Category: |
solvents |
| IUPAC Name: |
dimethyl methyl glutarate |
| InChI : |
InChI=1/C8H14O4/c1-6(8(10)12-3)4-5-7(9)11-2/h6H,4-5H2,1-3H3 |
| Std.InChI: |
InChI=1S/C8H14O4/c1-6(8(10)12-3)4-5-7(9)11-2/h6H,4-5H2,1-3H3 |
| InChIKey : |
ZWKKRUNHAVNSFW-UHFFFAOYAQ |
| Std.InChIKey: |
ZWKKRUNHAVNSFW-UHFFFAOYSA-N |
| SMILES : |
CC(CCC(=O)OC)C(=O)OC |
| Molar Refractivity : |
42.62 ± 0.3 cm3 (est) |
| Parachor : |
397.2 ± 4.0 cm3 (est) |
| Index of Refraction : |
1.421 ± 0.02 (est) |
| Surface Tension : |
31.3 ± 3.0 dyne/cm (est) |
| Density : |
1.037 ± 0.06 g/cm3 (est) |
| Polarizability : |
16.89 ± 0.5 10-24cm3 (est) |
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 204.00 to 205.00 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.264000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 195.00 °F. TCC ( 90.80 °C. ) (est) |
| logP (o/w): | 0.924 (est) |
| Soluble in: |
| | alcohol |
| | water, 4438 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
| Not determined |
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
| Category: |
| solvents |
| Recommendation for dimethyl methyl glutarate usage levels up to: |
| | not for fragrance use. |
| |
| Recommendation for dimethyl methyl glutarate flavor usage levels up to: |
| | not for flavor use. |
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| | dimethyl 2-methyl pentanedioate |
| | dimethyl 2-methylpentanedioate |
| | dimethyl methylglutarate |
| | glutaric acid, 2-methyl-, dimethyl ester |
| | pentanedioic acid, 2-methyl-, 1,5-dimethyl ester |
| | pentanedioic acid, 2-methyl-, dimethyl ester |
| | rhodiasolv IRIS |
