| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 13474-03-8 |
| FDA UNII: | RS300U3XL1 |
| Category: | flavor enhancers, flavoring agents |
| IUPAC Name: | 5'-adenylic acid sodium salt |
| InChI : | InChI=1/C10H14N5O7P.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);/q;+1/p-1/t4-,6-,7-,10-;/m1./s1 |
| Std.InChI: | InChI=1/C10H14N5O7P.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);/q;+1/p-1/t4-,6-,7-,10-;/m1./s1 |
| InChIKey : | FYWLYWMEGHCZAX-ADDHMGDDBM |
| Std.InChIKey: | FYWLYWMEGHCZAX-MCDZGGTQSA-M |
| SMILES : | C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)[O-])O)O.[Na+] |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| FDA/DG SANTE Petitions, Reviews, Notices: | |
| GRN 144 | Adenosine 5'-monophosphoric acid and its monosodium and disodium salts View - notice PDF |
| FEMA Number: | 4224 adenosine monophosphate; monosodium or disodium adenylate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 798.00 to 799.00 °C. @ 760.00 mm Hg (est) |
| Flash Point: | 818.00 °F. TCC ( 436.70 °C. ) (est) |
| logP (o/w): | -0.217 (est) |
| Soluble in: | |
| water, 1e+006 mg/L @ 25 °C (est) | |
| None found |
| Aromiens International |
| Adenosine 5'-monophosphate disodium salt |
| Axsyn |
| For experimental / research use only. |
| 5'-Adenylic acid,sodium salt (1:?) |
| BOC Sciences |
| For experimental / research use only. |
| ADENOSINE-5'-MONOPHOSPHATE SODIUM SALT(SH) > 95% |
| Carbosynth |
| For experimental / research use only. |
| Adenosine 5'-monophosphate sodium salt |
| Parchem |
| 5'-adenylic acid sodium salt |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| intraperitoneal-rat LD50 2049 mg/kg BEHAVIORAL: ALTERED SLEEP TIME (INCLUDING CHANGE IN RIGHTING REFLEX)BEHAVIORAL: ATAXIA Oyo Yakuri. Pharmacometrics. Vol. 4, Pg. 689, 1970. intraperitoneal-mouse LD50 2000 mg/kg Arzneimittel-Forschung. Drug Research. Vol. 7, Pg. 24, 1957. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| flavor enhancers, flavoring agents | |||
| Recommendation for 5'-adenylic acid sodium salt usage levels up to: | |||
| not for fragrance use. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 22 | |||
| Click here to view publication 22 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | 300.00000 | 800.00000 | |
| beverages(nonalcoholic): | 300.00000 | 800.00000 | |
| beverages(alcoholic): | 300.00000 | 800.00000 | |
| breakfast cereal: | 300.00000 | 800.00000 | |
| cheese: | 400.00000 | 800.00000 | |
| chewing gum: | 300.00000 | 800.00000 | |
| condiments / relishes: | 400.00000 | 800.00000 | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | 400.00000 | 800.00000 | |
| frozen dairy: | - | - | |
| fruit ices: | - | - | |
| gelatins / puddings: | - | - | |
| granulated sugar: | - | - | |
| gravies: | 400.00000 | 800.00000 | |
| hard candy: | - | - | |
| imitation dairy: | - | - | |
| instant coffee / tea: | 300.00000 | 800.00000 | |
| jams / jellies: | - | - | |
| meat products: | 500.00000 | 800.00000 | |
| milk products: | - | - | |
| nut products: | 400.00000 | 800.00000 | |
| other grains: | 300.00000 | 800.00000 | |
| poultry: | 500.00000 | 800.00000 | |
| processed fruits: | - | - | |
| processed vegetables: | 400.00000 | 800.00000 | |
| reconstituted vegetables: | 400.00000 | 800.00000 | |
| seasonings / flavors: | 400.00000 | 900.00000 | |
| snack foods: | 400.00000 | 900.00000 | |
| soft candy: | - | - | |
| soups: | 400.00000 | 800.00000 | |
| sugar substitutes: | 400.00000 | 800.00000 | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :23674992 |
| National Institute of Allergy and Infectious Diseases:Data |
| sodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| Chemidplus:0013474038 |
| sodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 23674992 |
| Pubchem (sid): | 134991015 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | Search |
| FDA Listing of Food Additive Status: | View |
| ChemSpider: | View |
| For Odor |
| earthy |
1- octen-3-olFL/FR |
| For Flavor |
| mushroom |
1- octen-3-olFL/FR |
| salty |
1-(2- hydroxy-4-isobutoxyphenyl)-3-(pyridin-2-yl)propan-1-oneFL |
1-(2- hydroxy-4-methoxyphenyl)-3-(pyridin-2-yl)propan-1-oneFL |
3-[3-(2-iso propyl-5-methyl cyclohexyl)ureido]-butyric acid ethyl esterFL |
| savory |
| disodium adenosine 5'-phosphate FL |
| umami |
| umami enhancers FL |
| umami flavor FL |
| yeasty |
| faex extracts FL |
| None Found |
| not found in nature |
| adenosine 5'-(dihydrogen phosphate) sodium salt | |
| adenosine 5'-(dihydrogen phosphate), sodium salt | |
| adenosine 5'-monophosphate sodium salt | |
| adenosine monophosphate; monosodium or disodium adenylate | |
| 5'- | adenylic acid, sodium salt |
| AMP sodium salt | |
| 5'- | AMP sodium salt |
| NaAmp | |
| sodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | |
| sodium 5'-O-(hydroxyphosphinato)adenosine | |
| sodium adenosine-5'-monophosphate | |
| sodium AMP |
| None found yet. Try the PubMed Search. |
