2-ethyl-5-methyl pyrazine and 2-ethyl-6-methyl pyrazine mixture
flavoring agents
| 2D: |
 |
| 3D: |
|
| CAS Number: |
13360-64-0
|
| ECHA EC Number: |
236-416-6 |
| FDA UNII: |
W41R8X574D |
| CoE Number: |
728 |
| Category: |
flavoring agents |
| IUPAC Name: |
2-ethyl-5-methyl pyrazine and 2-ethyl-6-methyl pyrazine mixture |
| InChI : |
InChI=1/C7H10N2/c1-3-7-5-8-6(2)4-9-7/h4-5H,3H2,1-2H3 |
| Std.InChI: |
InChI=1S/C7H10N2/c1-3-7-5-8-6(2)4-9-7/h4-5H,3H2,1-2H3 |
| InChIKey : |
OXCKCFJIKRGXMM-UHFFFAOYAK |
| Std.InChIKey: |
OXCKCFJIKRGXMM-UHFFFAOYSA-N |
| SMILES : |
CCC1=NC=C(N=C1)C |
| Molar Refractivity : |
36.80 ± 0.3 cm3 (est) |
| Parachor : |
309.8 ± 4.0 cm3 (est) |
| Index of Refraction : |
1.500 ± 0.02 (est) |
| Surface Tension : |
37.7 ± 3.0 dyne/cm (est) |
| Density : |
0.977 ± 0.06 g/cm3 (est) |
| Polarizability : |
14.59 ± 0.5 10-24cm3 (est) |
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless to pale yellow clear liquid (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 170.83 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 1.915000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 145.00 °F. TCC ( 63.00 °C. ) (est) |
| logP (o/w): | 1.197 (est) |
| Soluble in: |
| | alcohol |
| | water, 4903 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 900 mg/kg
Drug and Chemical Toxicology. Vol. 3, Pg. 249, 1980.
|
| Dermal Toxicity: |
| Not determined |
| Inhalation Toxicity: |
| Not determined |
Safety in Use Information:
| Category: |
| flavoring agents |
| Recommendation for 2-ethyl-5-methyl pyrazine and 2-ethyl-6-methyl pyrazine mixture usage levels up to: |
| | not for fragrance use. |
| |
Potential Blenders and core components :
Occurrence (nature, food, other):
Synonyms:
| 2- | ethyl-5-methylpyrazine and 2-ethyl-6-methylpyrazine mixture |
| 2- | ethyl-6-methyl pyrazine and 2-ethyl-5-methyl pyrazine mixture |
| 2- | ethyl-6-methylpyrazine and 2-ethyl-5-methylpyrazine mixture |
| | mixture of 2-ethyl-5-methylpyrazine and 2-ethyl-6-methylpyrazine |
