| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 123-94-4 |
| ECHA EC Number: | 204-664-4 |
| FDA UNII: | 258491E1RZ |
| Category: | solvents/deluents for flavor and/or fragrance agents |
| IUPAC Name: | glyceryl monostearate |
| InChI : | InChI=1/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| Std.InChI: | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey : | VBICKXHEKHSIBG-UHFFFAOYAT |
| Std.InChIKey: | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| SMILES : | CCCCCCCCCCCCCCCCCC(=O)OCC(CO)O |
| MDL: | MFCD00036186 |
| Molar Refractivity : | 104.14 ± 0.3 cm3 (est) |
| Parachor : | 923.2 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.468 ± 0.02 (est) |
| Surface Tension : | 37.1 ± 3.0 dyne/cm (est) |
| Density : | 0.958 ± 0.06 g/cm3 (est) |
| Polarizability : | 41.28 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 918 glyceryl monostearate |
| JECFA Food Additive: | Mono- and Diglycerides |
| GSFA Codex: | Mono- and di-glycerides of fatty acids (471) |
| FEMA Number: | 2527 glyceryl monostearate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| Appearance: | white waxy powder (est) |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Melting Point: | 56.00 to 58.00 °C. @ 760.00 mm Hg |
| Boiling Point: | 476.00 to 477.00 °C. @ 760.00 mm Hg |
| Acid Value: | 2.00 max. KOH/g |
| Saponification Value: | 160.00 to 175.00 |
| Flash Point: | > 200.00 °F. TCC ( > 93.33 °C. ) |
| logP (o/w): | 7.086 (est) |
| Shelf Life: | 12.00 month(s) or longer if stored properly. |
| Storage: | refrigerate in tightly sealed containers. |
| Soluble in: | |
| alcohol | |
| water, 0.0123 mg/L @ 25 °C (est) | |
| None found |
| Allan Chemical |
| Glyceryl Monostearate |
| American International Chemical, LLC. |
| Glycerol Monostearate |
| BOC Sciences |
| For experimental / research use only. |
| Glycerol mono-and distearate |
| Carbosynth |
| For experimental / research use only. |
| 1-Stearoyl-rac-glycerol |
| ECSA Chemicals |
| GLYCERYL MONOSTEARATE SE |
| ECSA TRADE THE MOST UPDATED FINANCIAL PUBLICATION ON THE WORLD OF CHEMISTRY |
| ECSA Chemicals |
| GLYCERYL MONOSTEARATE VEGETAL |
| Foodchem International |
| Distilled Glycerin Monostearate |
| Foreverest Resources |
| Glyceryl Monostearate GMS40 Odor: characteristic Use: Glyceryl monostearate (GMS) is an organic molecule used as an emulsifier in food. A glycerol ester of stearic acid, it is a colorless, odorless, sweet-tasting flaky powder. Glyceryl monostearate occurs naturally in the body as a by-product of the breakdown of fats, and is often found in fatty foods. |
| Foreverest Resources |
| Glyceryl Monostearate GMS90 Odor: characteristic Use: Glyceryl monostearate (GMS) is an organic molecule used as an emulsifier in food. A glycerol ester of stearic acid, it is a colorless, odorless, sweet-tasting flaky powder. Glyceryl monostearate occurs naturally in the body as a by-product of the breakdown of fats, and is often found in fatty foods. |
| Graham Chemical |
| Glyceryl Monostearate (Performer Fatty Acid Ester G1403) |
| Graham Chemical |
| Glyceryl Monostearate SE (Performer Fatty Acid Ester G1404) |
| HallStar |
| HALLSTAR® GMS PURE Odor: characteristic Use: HallStar GMS Pure is the esterification product of vegetable-derived, high-purity triple-pressed stearic acid with glycerin. It is one of the most broadly utilized ingredients for personal care products. HallStar GMS Pure is typically used as the primary emulsifier, in conjunction with a variety of auxiliary emulsifiers. The typical use level is 2 � 5% in creams and lotions.HallStar GMS Pure should be stored in sealed containers and kept in a cool, dry place. Prolonged storage above 90°F (32°C) should be avoided. Avoid overheating. |
| Jiangyin Healthway |
| Distilled glycerin monostearate(GMS) |
| New functional food ingredients |
| Jiangyin Healthway |
| Glyceryl monostearate |
| Kao Corporation |
| EXCEL VS-95 Flavor: characteristic Emulsifier for foods, Defoamer of TOFU making process, Antifogging agent for plastic films, Plastic lubricant, Antistatic agent for plastics.High-purity mono-glyceride with molecular distillation. Food use : Mild flavor. Excellent satiability. |
| Kao Corporation |
| RHEODOL MS-165V Odor: characteristic Use: Emulsifiers for pharmaceuticals and cosmetics, |
| Kao Corporation |
| RHEODOL MS-50 Odor: characteristic Use: Emulsifiers for pharmaceuticals and cosmetics, |
| Kao Corporation |
| RHEODOL MS-60 Odor: characteristic Use: Emulsifiers for pharmaceuticals and cosmetics, |
| Mosselman |
| Glycerol Monostearate 60% |
| Mosselman |
| Glycerol Monostearate 90% |
| Nactis Flavours |
| Glycerol Monostearate |
| OQEMA |
| LanCos GMS NSE |
| Penta International |
| GLYCERYL MONOSTEARATE FLAKES |
| Penta International |
| GLYCERYL MONOSTEARATE NF GRADE |
| Penta International |
| GLYCERYL MONOSTEARATE POWDER |
| Qingdao Dacon Trading |
| Glycerin Monostearate |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| 1-Stearoyl-rac-glycerol ≥99% |
| Sigma-Aldrich: Sigma |
| For experimental / research use only. |
| 1-Stearoyl-rac-glycerol ≥99% |
| Stepan Company |
| DREWMULSE® 200K FLAKE |
| TCI AMERICA |
| For experimental / research use only. |
| Monostearin >60.0%(GC) |
| Preferred SDS: View | |
| European information : | |
| Most important hazard(s): | |
| None - None found. | |
| S 02 - Keep out of the reach of children. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| solvents/deluents for flavor and/or fragrance agents | |||
| Recommendation for glyceryl monostearate usage levels up to: | |||
| not for fragrance use. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 3 | |||
| Click here to view publication 3 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | - | 1100.00000 | |
| beverages(nonalcoholic): | - | - | |
| beverages(alcoholic): | - | - | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | - | 1500.00000 | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | 2000.00000 | |
| fruit ices: | - | 2000.00000 | |
| gelatins / puddings: | - | - | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | 100.00000 | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):123-94-4 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :24699 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:1 |
| 2,3-dihydroxypropyl octadecanoate |
| Chemidplus:0000123944 |
| 2,3-dihydroxypropyl octadecanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 123-94-4 |
| Pubchem (cid): | 24699 |
| Pubchem (sid): | 134974752 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| CHEMBL: | View |
| KEGG (GenomeNet): | D01947 |
| HMDB (The Human Metabolome Database): | HMDB31075 |
| FooDB: | FDB003078 |
| Export Tariff Code: | 2915.70.0000 |
| FDA Listing of Food Additive Status: | View |
| ChemSpider: | View |
| Wikipedia: | View |
| None Found |
| emulsifying agents |
| not found in nature |
| abracol S.L.G. | |
| admul | |
| advawax 140 | |
| aldo HMS | |
| aldo MS | |
| arlacel 161 | |
| arlacel 169 | |
| armostat 801 | |
| cefatin | |
| celinhol - A | |
| cerasynt 1000-D | |
| cerasynt S | |
| cerasynt WM | |
| citomulgan M | |
| cyclochem GMS | |
| dermagine | |
| 2,3- | dihydroxypropyl octadecanoate |
| (1)-2,3- | dihydroxypropyl stearate |
| 2,3- | dihydroxypropyl stearate |
| drewmulse 200K | |
| drewmulse TP | |
| drewmulse V | |
| drumulse AA | |
| emcol CA | |
| emcol MSK | |
| emerest 2400 | |
| emerest 2401 | |
| emerest 2407 | |
| excel VS-95 | |
| glycerin 1-monostearate | |
| glycerin 1-stearate | |
| glycerol 1-monostearate | |
| glycerol 1-stearate | |
| glycerol a-monostearate | |
| glycerol monostearate | |
| glycerol monostearate finastat 9500 | |
| glyceryl 1-monostearate | |
| glyceryl monooctadecanoate | |
| 1- | glyceryl monooctadecanoate |
| 1- | glyceryl monostearate |
| glyceryl monostearate flakes | |
| glyceryl monostearate N.F. grade | |
| 1- | glyceryl stearate |
| glyceryl-1-monostearate | |
| grocor 5500 | |
| grocor 6000 | |
| hallstar GMS pure | |
| hallstar GMS pure C | |
| hodag GMS | |
| imwitor 191 | |
| imwitor 900K | |
| kessco 40 | |
| lipo GMS 450 | |
| lipo GMS 600 | |
| monelgin | |
| myvaplex 600 | |
| octadecanoic acid 2,3-dihydroxypropyl ester | |
| octadecanoic acid, 2,3-dihydroxypropyl ester | |
| octadecanoic acid, ester with 1,2,3-propanetriol | |
| octadecanoic acid, monoester with 1,2,3-propanetriol | |
| 1- | octadecanoyl-rac-glycerol |
| 1-mono | octadecanoyl-rac-glycerol |
| ogeen GRB | |
| ogeen M | |
| orbon | |
| protachem GMS | |
| sandin EU | |
| sedetine | |
| starfol GMS 450 | |
| starfol GMS 600 | |
| starfol GMS 900 | |
| stearic acid 1-monoglyceride | |
| stearic acid a-monoglyceride | |
| stearic acid alpha-monoglyceride | |
| stearic acid, monoester with glycerol | |
| stearic monoglyceride | |
| 1-mono | stearin |
| alpha-mono- | stearin |
| mono | stearin |
| mono- | stearin |
| stearin, 1-mono- | |
| 1-mono | stearoyl glycerol |
| 3- | stearoyl oxy-1,2-propane diol |
| 1- | stearoyl-rac-glycerol |
| stearoylglycerol | |
| 1-mono | stearoylglycerol |
| mono | stearoylglycerol |
| 3- | stearoyloxy-1,2-propanediol |
| tegin | |
| unimate GMS | |
| witconol MS |
