| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 1222-05-5 |
| ECHA EC Number: | 214-946-9 |
| FDA UNII: | 14170060AT |
| Category: | fragrance agents |
| IUPAC Name: | musk gx 100% |
| InChI : | InChI=1/C18H26O/c1-11-9-19-10-13-7-15-16(8-14(11)13)18(5,6)12(2)17(15,3)4/h7-8,11-12H,9-10H2,1-6H3 |
| Std.InChI: | InChI=1S/C18H26O/c1-11-9-19-10-13-7-15-16(8-14(11)13)18(5,6)12(2)17(15,3)4/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey : | ONKNPOPIGWHAQC-UHFFFAOYAG |
| Std.InChIKey: | ONKNPOPIGWHAQC-UHFFFAOYSA-N |
| SMILES : | CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C |
| MDL: | MFCD00217003 |
| Molar Refractivity : | 80.26 ± 0.3 cm3 (est) |
| Parachor : | 649.0 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.499 ± 0.02 (est) |
| Surface Tension : | 31.8 ± 3.0 dyne/cm (est) |
| Density : | 0.945 ± 0.06 g/cm3 (est) |
| Polarizability : | 31.81 ± 0.5 10-24cm3 (est) |
| Fragrance Demo Formulas | |
| Appearance: | colorless clear viscous liquid (est) |
| Assay: | 98.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 326.30 °C. @ 760.00 mm Hg (est) |
| Vapor Pressure: | 0.000414 mmHg @ 25.00 °C. (est) |
| Flash Point: | > 212.00 °F. TCC ( > 100.00 °C. ) |
| logP (o/w): | 5.300 |
| Shelf Life: | 36.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: | |
| alcohol | |
| dipropylene glycol | |
| paraffin oil | |
| water, 0.1943 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| CosIng: | cosmetic data |
| Cosmetic Uses: | fragrance perfuming agents |
| European information : | |
| Most important hazard(s): | |
| Xi N - Irritant, Dangerous for the environment. | |
| R 38 - Irritating to skin. R 50/53 - Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 24 - Avoid contact with skin. S 36 - Wear suitable protective clothing. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet. | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| Acute aquatic toxicity (Category 1), H400 Chronic aquatic toxicity (Category 1), H410 | |
| GHS Label elements, including precautionary statements | |
| Pictogram |  |
| Signal word | Warning |
| Hazard statement(s) | |
| H400 - Very toxic to aquatic life H410 - Very toxic to aquatic life with long lasting effects | |
| Precautionary statement(s) | |
| P273 - Avoid release to the environment. P391 - Collect spillage. Hazardous to the aquatic environment P501 - Dispose of contents/ container to an approved waste disposal plant. | |
| Oral/Parenteral Toxicity: | |
| oral-rat LDLo 3250 mg/kg Deutsche Lebensmittel - Rundschau. Vol. 94, Pg. 268, 1998. | |
| Dermal Toxicity: | |
| skin-rabbit LD > 3250 mg/kg Deutsche Lebensmittel - Rundschau. Vol. 94, Pg. 268, 1998. skin-rat LD50 > 5000 mg/kg Deutsche Lebensmittel - Rundschau. Vol. 94, Pg. 268, 1998. | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| fragrance agents | |||
| RIFM Fragrance Material Safety Assessment: Search | |||
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice | |||
| Recommendation for musk gx 100% usage levels up to: | |||
| 10.0000 % in the fragrance concentrate. | |||
| Recommendation for musk gx 100% flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| Chemical Carcinogenesis Research Information System:Search |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):1222-05-5 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :91497 |
| National Institute of Allergy and Infectious Diseases:Data |
| SCCNFP:opinion |
| WGK Germany:2 |
| 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylcyclopenta(g)-2-benzopyran |
| Chemidplus:0001222055 |
| Leffingwell: | Chirality or Article |
| 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylcyclopenta(g)-2-benzopyran | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 1222-05-5 |
| Pubchem (cid): | 91497 |
| Pubchem (sid): | 135049029 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| CHEBI: | View |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | Search |
| Export Tariff Code: | 3302.90.0010 |
| ChemSpider: | View |
| Wikipedia: | View |
| Formulations/Preparations: galaxolide 50 (65% hhcb in dep) | |
| FR | almond |
| FR | alpine bouquet |
| FR | amber |
| FR | angel essence |
| FR | apple |
| FR | balsam |
| FR | botanical |
| FR | bouquet |
| FR | carnation |
| FR | cedar |
| FR | cherry blossom |
| FR | christmas |
| clean | |
| FR | clean linen |
| FR | clove |
| FR | coral |
| design | |
| enhancer | |
| FR | floral |
| FR | florida breeze |
| FR | fresh and clean |
| FR | fruit |
| FR | green |
| FR | heather |
| FR | herbal |
| FR | hyacinth |
| FR | incense |
| FR | jasmin |
| jovan musk for men | |
| FR | juniper |
| FR | lavender |
| FR | lemon |
| FR | lily of the valley |
| FR | lime |
| lux beauty shower soap | |
| FR | moss |
| mure et musc | |
| FR | musk |
| FR | myrrh |
| FR | new car |
| FR | oriental |
| parfum sacre | |
| FR | peach |
| FR | pear |
| pert plus | |
| FR | pine |
| FR | potpourri |
| FR | powder |
| FR | rain |
| FR | raspberry |
| FR | rose |
| FR | sandalwood |
| FR | sea breeze |
| FR | strawberry |
| tresor | |
| FR | vanilla |
| waxy | |
| FR | woody |
| FR | ylang ylang |
| not found in nature |
| astrolide | |
| cyclopenta[g]-2-benzopyran, 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethyl- | |
| galaxolide 100% (IFF) | |
| hexahydro-4,6,6,7,8,8-hexamethyl cyclopenta-#-2-benzopyran | |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethyl cyclopenta-gamma-2-benzopryan |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethyl cyclopenta(g)-2-benzopyran |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethyl-cyclopenta-g-2-benzopyran |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethylcyclopenta(g)-2-benzopyran |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethylindeno(5,6-c)pyran |
| 1,3,4,6,7,8- | hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran |
| hexahydrohexamethyl cyclopentabenzopyran | |
| 4,6,6,7,8,8- | hexamethyl-1,3,4,6,7,8-hexahydrocyclopenta[g]isochromene |
| indeno[5,6-c]pyran, 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethyl- | |
| musk gx 100% |
