| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 106-19-4 |
| ECHA EC Number: | 203-371-9 |
| FDA UNII: | WB3LW508W0 |
| Category: | food-contact surface of paper and paperboard |
| IUPAC Name: | dipropyl adipate |
| InChI : | InChI=1/C12H22O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-10H2,1-2H3 |
| Std.InChI: | InChI=1S/C12H22O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-10H2,1-2H3 |
| InChIKey : | NKOUWLLFHNBUDW-UHFFFAOYAP |
| Std.InChIKey: | NKOUWLLFHNBUDW-UHFFFAOYSA-N |
| SMILES : | CCCOC(=O)CCCCC(=O)OCCC |
| MDL: | MFCD00048696 |
| Molar Refractivity : | 61.19 ± 0.3 cm3 (est) |
| Parachor : | 559.0 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.436 ± 0.02 (est) |
| Surface Tension : | 32.8 ± 3.0 dyne/cm (est) |
| Density : | 0.985 ± 0.06 g/cm3 (est) |
| Polarizability : | 24.25 ± 0.5 10-24cm3 (est) |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| JECFA Food Flavoring: | 1965 dipropyl adipate |
| FEMA Number: | 4473 dipropyl adipate |
| FDA: | No longer provide for the use of these seven synthetic flavoring substances |
| FDA Mainterm (SATF): | 106-19-4 ; DIPROPYL ADIPATE |
| Appearance: | colorless clear liquid (est) |
| Assay: | 98.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.97900 to 0.98300 @ 20.00 °C. |
| Pounds per Gallon - (est).: | 8.156 to 8.189 |
| Refractive Index: | 1.42900 to 1.43300 @ 20.00 °C. |
| Melting Point: | -15.70 °C. @ 760.00 mm Hg |
| Boiling Point: | 273.00 to 274.00 °C. @ 760.00 mm Hg |
| Acid Value: | 1.00 max. KOH/g |
| Vapor Pressure: | 0.005000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 253.00 °F. TCC ( 122.78 °C. ) |
| logP (o/w): | 2.988 (est) |
| Soluble in: | |
| alcohol | |
| water, very slightly | |
| water, 41.65 mg/L @ 25 °C (est) | |
| Insoluble in: | |
| water | |
| BOC Sciences |
| For experimental / research use only. |
| Dipropyl Adipate >99.0%(GC) |
| Inoue Perfumery |
| DIPROPYL ADIPATE |
| Penta International |
| DIPROPYL ADIPATE |
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Dipropyl Adipate |
| Sigma-Aldrich: Aldrich |
| For experimental / research use only. |
| Dipropyl hexanedioate |
| TCI AMERICA |
| For experimental / research use only. |
| Dipropyl Adipate >98.0%(GC) |
| Preferred SDS: View | |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| intraperitoneal-rat LD50 3786 uL/kg Journal of Pharmaceutical Sciences. Vol. 62, Pg. 1596, 1973. | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| food-contact surface of paper and paperboard | |||
| Recommendation for dipropyl adipate usage levels up to: | |||
| not for fragrance use. | |||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | |||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library | |||
| publication number: 24 | |||
| Click here to view publication 24 | |||
| average usual ppm | average maximum ppm | ||
| baked goods: | 556.00000 | 600.00000 | |
| beverages(nonalcoholic): | 0.10000 | 2.00000 | |
| beverages(alcoholic): | - | - | |
| breakfast cereal: | - | - | |
| cheese: | - | - | |
| chewing gum: | - | - | |
| condiments / relishes: | - | - | |
| confectionery froastings: | - | - | |
| egg products: | - | - | |
| fats / oils: | - | - | |
| fish products: | - | - | |
| frozen dairy: | - | - | |
| fruit ices: | - | - | |
| gelatins / puddings: | - | - | |
| granulated sugar: | - | - | |
| gravies: | - | - | |
| hard candy: | - | - | |
| imitation dairy: | - | - | |
| instant coffee / tea: | - | - | |
| jams / jellies: | - | - | |
| meat products: | - | - | |
| milk products: | - | - | |
| nut products: | - | - | |
| other grains: | - | - | |
| poultry: | - | - | |
| processed fruits: | - | - | |
| processed vegetables: | - | - | |
| reconstituted vegetables: | - | - | |
| seasonings / flavors: | - | - | |
| snack foods: | - | - | |
| soft candy: | - | - | |
| soups: | - | - | |
| sugar substitutes: | - | - | |
| sweet sauces: | - | - | |
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):106-19-4 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :7790 |
| National Institute of Allergy and Infectious Diseases:Data |
| WGK Germany:1 |
| dipropyl hexanedioate |
| Chemidplus:0000106194 |
| RTECS:AV1740000 for cas# 106-19-4 |
| dipropyl hexanedioate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 7790 |
| Pubchem (sid): | 134971493 |
| Pherobase: | View |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| FDA Indirect Additives used in Food Contact Substances: | View |
| CHEMBL: | View |
| HMDB (The Human Metabolome Database): | HMDB41614 |
| FooDB: | FDB021774 |
| Export Tariff Code: | 2917.12.5000 |
| ChemSpider: | View |
| FAO: | Dipropyl adipate |
| None Found |
| emollients | |
| skin conditioning | |
| solvents |
| not found in nature |
| adipic acid dipropyl ester | |
| adipic acid, di-n-propyl ester | |
| adipic acid, dipropyl ester | |
| di-n-propyl adipate | |
| dipropyl hexane dioate | |
| dipropyl hexane-1,6-dioate | |
| dipropyl hexanedioate | |
| hexane dioic acid dipropyl ester | |
| hexanedioic acid dipropyl ester | |
| hexanedioic acid, dipropyl ester | |
| hexanedioic acid,1,6-dipropyl ester |
| None found yet. Try the PubMed Search. |
