| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 10415-86-8 |
| ECHA EC Number: | 233-888-5 |
| FDA UNII: | JPT2OXN70I |
| Category: | information only not used for fragrances or flavors |
| IUPAC Name: | para-cresyl valerate |
| InChI : | InChI=1/C12H16O2/c1-3-4-5-12(13)14-11-8-6-10(2)7-9-11/h6-9H,3-5H2,1-2H3 |
| Std.InChI: | InChI=1S/C12H16O2/c1-3-4-5-12(13)14-11-8-6-10(2)7-9-11/h6-9H,3-5H2,1-2H3 |
| InChIKey : | XDIFYXKFWPNGRV-UHFFFAOYAI |
| Std.InChIKey: | XDIFYXKFWPNGRV-UHFFFAOYSA-N |
| SMILES : | CCCCC(=O)OC1=CC=C(C=C1)C |
| Molar Refractivity : | 56.31 ± 0.3 cm3 (est) |
| Parachor : | 465.7 ± 4.0 cm3 (est) |
| Index of Refraction : | 1.495 ± 0.02 (est) |
| Surface Tension : | 34.0 ± 3.0 dyne/cm (est) |
| Density : | 0.996 ± 0.06 g/cm3 (est) |
| Polarizability : | 22.32 ± 0.5 10-24cm3 (est) |
| Fragrance Demo Formulas | |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| p-Cresyl valerate |
| Inoue Perfumery |
| P-CRESYL VALERATE |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| information only not used for fragrances or flavors | |||
| Recommendation for para-cresyl valerate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for para-cresyl valerate flavor usage levels up to: | |||
| not for flavor use. | |||
| EPI System: View |
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):10415-86-8 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :82613 |
| National Institute of Allergy and Infectious Diseases:Data |
| (4-methylphenyl) pentanoate |
| Chemidplus:0010415868 |
| (4-methylphenyl) pentanoate | |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 10415-86-8 |
| Pubchem (cid): | 82613 |
| Pubchem (sid): | 135041841 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| FR | civet |
| not found in nature |
| p- | cresyl valerate |
| 4- | methyl phenyl valerate |
| 4- | methylphenyl valerate |
| (4- | methylphenyl) pentanoate |
| pentanoic acid 4-methyl phenyl ester | |
| pentanoic acid 4-methylphenyl ester | |
| p- | tolyl valerate |
| para- | tolyl valerate |
| None found yet. Try the PubMed Search. |
