| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 10045-87-1 |
| ECHA EC Number: | 233-150-2 |
| FDA UNII: | NGH4LHX6XQ |
| Category: | nutrient supplements |
| IUPAC Name: | sodium ferric pyrophosphate |
| InChI : | InChI=1/Fe.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4 |
| Std.InChI: | InChI=1S/Fe.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4 |
| InChIKey : | XWQGIDJIEPIQBD-XBHQNQODAM |
| Std.InChIKey: | XWQGIDJIEPIQBD-UHFFFAOYSA-J |
| SMILES : | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Na+].[Fe+3] |
| Google Scholar: | Search |
| Google Books: | Search |
| Google Scholar: with word "volatile" | Search |
| Google Scholar: with word "flavor" | Search |
| Google Scholar: with word "odor" | Search |
| Perfumer and Flavorist: | Search |
| Google Patents: | Search |
| US Patents: | Search |
| EU Patents: | Search |
| Pubchem Patents: | Search |
| PubMed: | Search |
| NCBI: | Search |
| FDA/DG SANTE Petitions, Reviews, Notices: | |
| 1980 | Ferric sodium pyrophosphate View - review |
| FDA Mainterm (SATF): | 10045-87-1 ; FERRIC SODIUM PYROPHOSPHATE |
| Food Chemicals Codex Listed: | No |
| Flash Point: | 32.00 °F. TCC ( 0.00 °C. ) (est) |
| logP (o/w): | -3.420 (est) |
| None found |
| BOC Sciences |
| For experimental / research use only. |
| iron sodium diphosphate 95% |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| nutrient supplements | |||
| Recommendation for sodium ferric pyrophosphate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for sodium ferric pyrophosphate flavor usage levels up to: | |||
| not for flavor use. | |||
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :24862 |
| National Institute of Allergy and Infectious Diseases:Data |
| sodium; iron(3+); phosphonato phosphate |
| Chemidplus:0010045871 |
| sodium; iron(3+); phosphonato phosphate | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 24862 |
| Pubchem (sid): | 134990789 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| FDA Substances Added to Food (formerly EAFUS): | View |
| HMDB (The Human Metabolome Database): | Search |
| FooDB: | FDB016957 |
| FDA Listing of Food Additive Status: | View |
| ChemSpider: | View |
| Formulations/Preparations: a complex sodium iron (or ferric) pyrophosphate(sip), na8fe4(p2o7)5.xh2o (formula derived from the molecular ratios obtained by chemical analysis), also is used to some extent as an iron-enrichment compound in food formulations. | |
| None Found |
| None Found |
| not found in nature |
| diphosphoric acid iron(3+) sodium salt (1:1:1) | |
| ferric sodium pyrophosphate | |
| iron sodium pyrophosphate (NaFeP2O7) | |
| iron(III) sodium pyrophosphate | |
| pyrophosphoric acid iron(3+) sodium salt (1:1:1) | |
| sodium; iron(3+); phosphonato phosphate |
| None found yet. Try the PubMed Search. |
