| 2D: |  |
|---|---|
| 3D: | |
| CAS Number: | 10042-67-8 |
| ECHA EC Number: | 233-129-8 |
| FDA UNII: | Q396OZT9DA |
| Category: | emulsifiers, surfactants |
| IUPAC Name: | TIPA-stearate |
| InChI : | InChI=1/C18H36O2.C9H21NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(11)4-10(5-8(2)12)6-9(3)13/h2-17H2,1H3,(H,19,20);7-9,11-13H,4-6H2,1-3H3 |
| Std.InChI: | InChI=1S/C18H36O2.C9H21NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(11)4-10(5-8(2)12)6-9(3)13/h2-17H2,1H3,(H,19,20);7-9,11-13H,4-6H2,1-3H3 |
| InChIKey : | PJXWYLSAKUNJSC-UHFFFAOYAL |
| Std.InChIKey: | PJXWYLSAKUNJSC-UHFFFAOYSA-N |
| SMILES : | CCCCCCCCCCCCCCCCCC(=O)O.CC(CN(CC(C)O)CC(C)O)O |
| Assay: | 95.00 to 100.00 |
| Food Chemicals Codex Listed: | No |
| None found |
| Hazards identification | |
| Classification of the substance or mixture | |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) | |
| None found. | |
| GHS Label elements, including precautionary statements | |
| Pictogram | |
| Hazard statement(s) | |
| None found. | |
| Precautionary statement(s) | |
| None found. | |
| Oral/Parenteral Toxicity: | |
| Not determined | |
| Dermal Toxicity: | |
| Not determined | |
| Inhalation Toxicity: | |
| Not determined | |
| Category: | |||
| emulsifiers, surfactants | |||
| Recommendation for TIPA-stearate usage levels up to: | |||
| not for fragrance use. | |||
| Recommendation for TIPA-stearate flavor usage levels up to: | |||
| not for flavor use. | |||
| AIDS Citations:Search |
| Cancer Citations:Search |
| Toxicology Citations:Search |
| EPA Substance Registry Services (TSCA):10042-67-8 |
| EPA ACToR:Toxicology Data |
| EPA Substance Registry Services (SRS):Registry |
| Laboratory Chemical Safety Summary :165801 |
| National Institute of Allergy and Infectious Diseases:Data |
| 1-[bis(2-hydroxypropyl)amino]propan-2-ol;octadecanoic acid |
| Chemidplus:0010042678 |
| 1-[bis(2-hydroxypropyl)amino]propan-2-ol;octadecanoic acid | |
| NIST Chemistry WebBook: | Search Inchi |
| Pubchem (cid): | 165801 |
| Pubchem (sid): | 135120693 |
| (IUPAC): | Atomic Weights of the Elements 2011 (pdf) |
| Videos: | The Periodic Table of Videos |
| tgsc: | Atomic Weights use for this web site |
| (IUPAC): | Periodic Table of the Elements |
| HMDB (The Human Metabolome Database): | Search |
| ChemSpider: | View |
| None Found |
| emulsifying agents | |
| surfactants |
| not found in nature |
| 1-[bis(2- | hydroxypropyl)amino]propan-2-ol;octadecanoic acid |
| octadecanoic acid, compd. with 1,1',1''-nitrilotris(2-propanol) (1:1) | |
| stearic acid, compd. with 1,1',1''-nitrilotris(2-proanol) (1:1) | |
| triisopropanolamine monostearate |
| None found yet. Try the PubMed Search. |
